The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(((2-(2-(2-((Rutaecarpin-3-yl)oxy)ethoxy)ethoxy)ethyl)amino)methyl)-4-(naphtha-1-yl)-1,2,5-oxadiazole-2-oxide ID: ALA4461959
PubChem CID: 155528728
Max Phase: Preclinical
Molecular Formula: C37H34N6O6
Molecular Weight: 658.72
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=c1c2cc(OCCOCCOCCNCc3c(-c4cccc5ccccc45)no[n+]3[O-])ccc2nc2n1CCc1c-2[nH]c2ccccc12
Standard InChI: InChI=1S/C37H34N6O6/c44-37-30-22-25(12-13-32(30)40-36-35-29(14-16-42(36)37)27-9-3-4-11-31(27)39-35)48-21-20-47-19-18-46-17-15-38-23-33-34(41-49-43(33)45)28-10-5-7-24-6-1-2-8-26(24)28/h1-13,22,38-39H,14-21,23H2
Standard InChI Key: YKIYURNSEYXAOQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
49 56 0 0 0 0 0 0 0 0999 V2000
47.2503 -16.4967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.2494 -15.6795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.5407 -16.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.5412 -17.7206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.2499 -18.1293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.5378 -15.2713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.8560 -15.1346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
47.5239 -14.3858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.7092 -14.4704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
46.1633 -13.8624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.6266 -15.2854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3346 -15.6944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0443 -15.2850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0415 -14.4623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6277 -14.4659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3343 -14.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3350 -13.2479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9219 -14.0621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0436 -12.8409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.9243 -13.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6335 -12.8385 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.6361 -12.0256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9311 -11.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2177 -12.8386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2254 -12.0197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4365 -13.0843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9613 -12.4173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4486 -11.7623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1248 -11.0150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3140 -10.9214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8281 -11.5813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1546 -12.3260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7526 -15.6924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.4597 -15.2827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1681 -15.6902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8751 -15.2805 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.5835 -15.6880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2905 -15.2783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9989 -15.6858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.7060 -15.2761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4143 -15.6836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1214 -15.2739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.8297 -15.6813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.9555 -16.9005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.9559 -17.7123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.6580 -18.1161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
49.3602 -17.7092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
49.3559 -16.8943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.6532 -16.4942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
3 4 1 0
4 5 2 0
5 45 1 0
44 1 1 0
6 2 1 0
2 7 2 0
7 8 1 0
8 9 1 0
9 6 2 0
9 10 1 0
15 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 16 2 0
15 16 1 0
15 18 1 0
16 17 1 0
17 21 1 0
20 18 2 0
17 19 2 0
20 21 1 0
20 24 1 0
21 22 1 0
22 23 1 0
23 25 1 0
24 25 2 0
25 28 1 0
27 26 1 0
26 24 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
13 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 6 1 0
44 45 1 0
45 46 2 0
46 47 1 0
47 48 2 0
48 49 1 0
49 44 2 0
M CHG 2 9 1 10 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 658.72Molecular Weight (Monoisotopic): 658.2540AlogP: 4.74#Rotatable Bonds: 13Polar Surface Area: 143.37Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.44CX Basic pKa: 5.98CX LogP: 2.44CX LogD: 2.42Aromatic Rings: 7Heavy Atoms: 49QED Weighted: 0.13Np Likeness Score: -0.48
References 1. Ma J, Chen L, Fan J, Cao W, Zeng G, Wang Y, Li Y, Zhou Y, Deng X.. (2019) Dual-targeting Rutaecarpine-NO donor hybrids as novel anti-hypertensive agents by promoting release of CGRP., 168 [PMID:30818175 ] [10.1016/j.ejmech.2019.02.037 ]