N2-(7-(4-(Pyridin-3-yl)-1H-1,2,3-triazol-1-yl)heptyl)-[1,1'-biphenyl]-2,2'-dicarboxamide

ID: ALA4462010

PubChem CID: 117679407

Max Phase: Preclinical

Molecular Formula: C28H30N6O2

Molecular Weight: 482.59

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=O)c1ccccc1-c1ccccc1C(=O)NCCCCCCCn1cc(-c2cccnc2)nn1

Standard InChI:  InChI=1S/C28H30N6O2/c29-27(35)24-14-6-4-12-22(24)23-13-5-7-15-25(23)28(36)31-17-8-2-1-3-9-18-34-20-26(32-33-34)21-11-10-16-30-19-21/h4-7,10-16,19-20H,1-3,8-9,17-18H2,(H2,29,35)(H,31,36)

Standard InChI Key:  TTWZWSLHJGJICI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    2.3194  -15.7798    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1349  -15.7810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5418  -15.0765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1344  -14.3704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3159  -14.3732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9126  -15.0783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3621  -15.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8423  -15.7347    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6196  -15.4824    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6198  -14.6651    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8426  -14.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3229  -14.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0340  -14.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7383  -14.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4494  -14.6422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1536  -14.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8647  -14.6304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5690  -14.2159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2801  -14.6186    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9844  -14.2041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6955  -14.6068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9776  -13.3870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6994  -15.4245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4097  -15.8271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1149  -15.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1055  -14.5912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3947  -14.1923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3833  -13.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0877  -12.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0784  -12.1455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3653  -11.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6602  -12.1659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6731  -12.9808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7998  -13.3628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8087  -14.1799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5031  -12.9465    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11  7  2  0
  3  7  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 21  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 27 28  1  0
 29 34  1  0
 34 35  2  0
 34 36  1  0
M  END

Associated Targets(Human)

SH-SY5Y (11521 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Nampt Nicotinamide phosphoribosyltransferase (67 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.59Molecular Weight (Monoisotopic): 482.2430AlogP: 4.49#Rotatable Bonds: 12
Polar Surface Area: 115.79Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.08CX LogP: 4.12CX LogD: 4.12
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -1.33

References

1. Travelli C, Aprile S, Mattoteia D, Colombo G, Clemente N, Scanziani E, Terrazzino S, Alisi MA, Polenzani L, Grosa G, Genazzani AA, Tron GC, Galli U..  (2019)  Identification of potent triazolylpyridine nicotinamide phosphoribosyltransferase (NAMPT) inhibitors bearing a 1,2,3-triazole tail group.,  181  [PMID:31400709] [10.1016/j.ejmech.2019.111576]

Source