The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N2-(7-(4-(Pyridin-3-yl)-1H-1,2,3-triazol-1-yl)heptyl)-[1,1'-biphenyl]-2,2'-dicarboxamide ID: ALA4462010
PubChem CID: 117679407
Max Phase: Preclinical
Molecular Formula: C28H30N6O2
Molecular Weight: 482.59
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1ccccc1-c1ccccc1C(=O)NCCCCCCCn1cc(-c2cccnc2)nn1
Standard InChI: InChI=1S/C28H30N6O2/c29-27(35)24-14-6-4-12-22(24)23-13-5-7-15-25(23)28(36)31-17-8-2-1-3-9-18-34-20-26(32-33-34)21-11-10-16-30-19-21/h4-7,10-16,19-20H,1-3,8-9,17-18H2,(H2,29,35)(H,31,36)
Standard InChI Key: TTWZWSLHJGJICI-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
2.3194 -15.7798 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1349 -15.7810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5418 -15.0765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1344 -14.3704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3159 -14.3732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9126 -15.0783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3621 -15.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8423 -15.7347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6196 -15.4824 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6198 -14.6651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8426 -14.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3229 -14.2513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0340 -14.6540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7383 -14.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4494 -14.6422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1536 -14.2277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8647 -14.6304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5690 -14.2159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2801 -14.6186 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9844 -14.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6955 -14.6068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9776 -13.3870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6994 -15.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4097 -15.8271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1149 -15.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1055 -14.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3947 -14.1923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3833 -13.3782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0877 -12.9618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0784 -12.1455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3653 -11.7445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6602 -12.1659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6731 -12.9808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7998 -13.3628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8087 -14.1799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5031 -12.9465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 7 2 0
3 7 1 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
27 28 1 0
29 34 1 0
34 35 2 0
34 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.59Molecular Weight (Monoisotopic): 482.2430AlogP: 4.49#Rotatable Bonds: 12Polar Surface Area: 115.79Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.08CX LogP: 4.12CX LogD: 4.12Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -1.33
References 1. Travelli C, Aprile S, Mattoteia D, Colombo G, Clemente N, Scanziani E, Terrazzino S, Alisi MA, Polenzani L, Grosa G, Genazzani AA, Tron GC, Galli U.. (2019) Identification of potent triazolylpyridine nicotinamide phosphoribosyltransferase (NAMPT) inhibitors bearing a 1,2,3-triazole tail group., 181 [PMID:31400709 ] [10.1016/j.ejmech.2019.111576 ]