4-(5-(4-(5-(4-hydroxy-2-methoxyphenyl)-1,3,4-oxadiazol-2-yl)phenyl)-1,3,4-thia-diazol-2-yl)benzene-1,2-diol

ID: ALA4462023

PubChem CID: 155528982

Max Phase: Preclinical

Molecular Formula: C23H16N4O5S

Molecular Weight: 460.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)ccc1-c1nnc(-c2ccc(-c3nnc(-c4ccc(O)c(O)c4)s3)cc2)o1

Standard InChI:  InChI=1S/C23H16N4O5S/c1-31-19-11-15(28)7-8-16(19)21-25-24-20(32-21)12-2-4-13(5-3-12)22-26-27-23(33-22)14-6-9-17(29)18(30)10-14/h2-11,28-30H,1H3

Standard InChI Key:  NCUQJRGLDCFGFM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    2.6318  -10.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6306  -11.3769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3387  -11.7859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0483  -11.3765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0455  -10.5538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3369  -10.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9226  -11.7850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3344   -9.3314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6255   -8.9249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7494  -10.1442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4972  -10.4738    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0417   -9.8644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6304   -9.1582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7740   -9.3312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9569   -8.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7705   -8.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1000   -7.5780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6170   -6.9178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8007   -7.0094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4749   -7.7566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9419   -6.1711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7403   -5.9971    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8215   -5.1839    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0732   -4.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5296   -5.4367    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.9087   -4.0549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5207   -3.5147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3568   -2.7149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5806   -2.4564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9682   -3.0038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1353   -3.8016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9681   -2.1725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4151   -1.6561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  6  8  1  0
  8  9  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  1  0
  5 10  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  1  0
 18 21  1  0
 24 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 28 32  1  0
 29 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4462023

    ---

Associated Targets(Human)

GUSB Tchem Beta-glucuronidase (537 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.47Molecular Weight (Monoisotopic): 460.0841AlogP: 4.71#Rotatable Bonds: 5
Polar Surface Area: 134.62Molecular Species: NEUTRALHBA: 10HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.26CX Basic pKa: 0.05CX LogP: 3.76CX LogD: 3.70
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.32Np Likeness Score: -0.30

References

1. Taha M, Imran S, Alomari M, Rahim F, Wadood A, Mosaddik A, Uddin N, Gollapalli M, Alqahtani MA, Bamarouf YA..  (2019)  Synthesis of oxadiazole-coupled-thiadiazole derivatives as a potent β-glucuronidase inhibitors and their molecular docking study.,  27  (14): [PMID:31196753] [10.1016/j.bmc.2019.05.049]

Source