The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-((5-((2-Chloro-6-methylbenzyl)oxy)-2-((4-(4-methylpiperazin-1-yl)phenyl)amino)pyrimidin-4-yl)amino)phenyl)acrylamide ID: ALA4462060
PubChem CID: 155415472
Max Phase: Preclinical
Molecular Formula: C32H34ClN7O2
Molecular Weight: 584.12
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1ccccc1Nc1nc(Nc2ccc(N3CCN(C)CC3)cc2)ncc1OCc1c(C)cccc1Cl
Standard InChI: InChI=1S/C32H34ClN7O2/c1-4-30(41)36-27-10-5-6-11-28(27)37-31-29(42-21-25-22(2)8-7-9-26(25)33)20-34-32(38-31)35-23-12-14-24(15-13-23)40-18-16-39(3)17-19-40/h4-15,20H,1,16-19,21H2,2-3H3,(H,36,41)(H2,34,35,37,38)
Standard InChI Key: CLSGGSAGLNZLNG-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
16.4373 -23.7233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4362 -24.5428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1442 -24.9518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8539 -24.5423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8511 -23.7197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1424 -23.3144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7282 -24.9508 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5622 -24.9498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7275 -25.7680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5635 -25.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0194 -26.1745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0184 -26.9910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7263 -27.4009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4367 -26.9885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4342 -26.1734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8552 -26.1752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8561 -26.9916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5650 -27.3999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2744 -26.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2700 -26.1707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7267 -28.2181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0166 -28.6238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0151 -29.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7212 -29.8495 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4305 -29.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4337 -28.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7185 -30.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9756 -25.7586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6854 -26.1637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3910 -25.7517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1008 -26.1568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6894 -26.9809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5572 -23.3084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2665 -23.7143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9726 -23.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6803 -23.7124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3860 -23.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3833 -22.4838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6691 -22.0780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9664 -22.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6813 -24.5296 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
19.2555 -22.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
4 8 1 0
7 9 1 0
8 10 1 0
9 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 9 1 0
10 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 10 1 0
13 21 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
20 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
29 32 2 0
5 33 1 0
33 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
36 41 1 0
40 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 584.12Molecular Weight (Monoisotopic): 583.2463AlogP: 6.38#Rotatable Bonds: 10Polar Surface Area: 94.65Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.91CX Basic pKa: 7.96CX LogP: 6.84CX LogD: 6.17Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.19Np Likeness Score: -1.32
References 1. Du G, Rao S, Gurbani D, Henning NJ, Jiang J, Che J, Yang A, Ficarro SB, Marto JA, Aguirre AJ, Sorger PK, Westover KD, Zhang T, Gray NS.. (2020) Structure-Based Design of a Potent and Selective Covalent Inhibitor for SRC Kinase That Targets a P-Loop Cysteine., 63 (4): [PMID:31935084 ] [10.1021/acs.jmedchem.9b01502 ]