N-[5-n-butyl-4-(4-hydroxyphenyl)thiazol-2-yl]-3,4,5-trihydroxybenzamide

ID: ALA4462128

PubChem CID: 57991650

Max Phase: Preclinical

Molecular Formula: C20H20N2O5S

Molecular Weight: 400.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCc1sc(NC(=O)c2cc(O)c(O)c(O)c2)nc1-c1ccc(O)cc1

Standard InChI:  InChI=1S/C20H20N2O5S/c1-2-3-4-16-17(11-5-7-13(23)8-6-11)21-20(28-16)22-19(27)12-9-14(24)18(26)15(25)10-12/h5-10,23-26H,2-4H2,1H3,(H,21,22,27)

Standard InChI Key:  YVXOGXMXIINHDS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   40.0134  -13.2980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8306  -13.2980    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.0850  -12.5213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4220  -12.0391    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   39.7633  -12.5213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8626  -12.2698    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.9860  -12.2691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5328  -13.9554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7192  -13.8675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2382  -14.5272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5696  -15.2751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3867  -15.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8641  -14.6988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0893  -15.9363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.8157  -11.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0384  -11.2176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8682  -10.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4691  -12.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2466  -12.5660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2981  -13.6166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.8491  -13.1157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6260  -12.8648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7976  -12.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1862  -11.5165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4116  -11.7702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2323  -13.4128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.5748  -11.8125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.3544  -10.7168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  1  2  0
  3  6  1  0
  5  7  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  1  8  1  0
 11 14  1  0
  7 15  1  0
 15 16  1  0
 16 17  1  0
  6 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 19  1  0
 22 26  1  0
 23 27  1  0
 24 28  1  0
M  END

Associated Targets(Human)

PLTP Tbio Phospholipid transfer protein (94 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CETP Tchem Cholesteryl ester transfer protein (2422 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 400.46Molecular Weight (Monoisotopic): 400.1093AlogP: 4.23#Rotatable Bonds: 6
Polar Surface Area: 122.91Molecular Species: NEUTRALHBA: 7HBD: 5
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 8.08CX Basic pKa: CX LogP: 5.21CX LogD: 5.12
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.39Np Likeness Score: -0.70

References

1.  (2014)  2,4,5-trisubstituted thiazole compounds,preparation methods,pharmaceutical compositions and medical uses thereof, 
2.  (2016)  2,4,5-trisubstituted thiazole compounds,preparation methods,pharmaceutical compositions and medical uses thereof, 

Source