The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Methyl-3,5-dinitro-N-(4-nitrophenyl)benzamide ID: ALA4462402
PubChem CID: 3109294
Max Phase: Preclinical
Molecular Formula: C14H10N4O7
Molecular Weight: 346.26
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c([N+](=O)[O-])cc(C(=O)Nc2ccc([N+](=O)[O-])cc2)cc1[N+](=O)[O-]
Standard InChI: InChI=1S/C14H10N4O7/c1-8-12(17(22)23)6-9(7-13(8)18(24)25)14(19)15-10-2-4-11(5-3-10)16(20)21/h2-7H,1H3,(H,15,19)
Standard InChI Key: JIBKLGXTBAUFLB-UHFFFAOYSA-N
Molfile:
RDKit 2D
25 26 0 0 0 0 0 0 0 0999 V2000
12.4050 -10.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4039 -11.7897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1119 -12.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8216 -11.7892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8188 -10.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1101 -10.5613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5249 -10.5553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2342 -10.9612 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5218 -9.7381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1117 -13.0158 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4039 -13.4243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8193 -13.4246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6972 -10.5617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6970 -9.7445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9896 -10.9705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9403 -10.5499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6480 -10.9593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3537 -10.5487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3510 -9.7306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6368 -9.3249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9341 -9.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0567 -9.3184 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7664 -9.7234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0525 -8.5013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6959 -12.1977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
3 10 1 0
10 11 1 0
10 12 2 0
1 13 1 0
13 14 1 0
13 15 2 0
8 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 2 0
22 24 1 0
2 25 1 0
M CHG 6 10 1 11 -1 13 1 14 -1 22 1 24 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 346.26Molecular Weight (Monoisotopic): 346.0549AlogP: 2.97#Rotatable Bonds: 5Polar Surface Area: 158.52Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.85CX Basic pKa: ┄CX LogP: 3.40CX LogD: 3.40Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.64Np Likeness Score: -1.51
References 1. Güngör T, Önder FC, Tokay E, Gülhan ÜG, Hacıoğlu N, Tok TT, Çelik A, Köçkar F, Ay M.. (2019) PRODRUGS FOR NITROREDUCTASE BASED CANCER THERAPY- 2: Novel amide/Ntr combinations targeting PC3 cancer cells., 171 [PMID:30928710 ] [10.1016/j.ejmech.2019.03.035 ]