The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(1-(3-(4-(3-aminopropylamino)butylamino)propylamino)-3-cyclohexyl-1-oxopropan-2-yl)cinnamamide ID: ALA4462550
PubChem CID: 155529181
Max Phase: Preclinical
Molecular Formula: C28H47N5O2
Molecular Weight: 485.72
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCCCNCCCCNCCCNC(=O)[C@H](CC1CCCCC1)NC(=O)/C=C/c1ccccc1
Standard InChI: InChI=1S/C28H47N5O2/c29-17-9-20-30-18-7-8-19-31-21-10-22-32-28(35)26(23-25-13-5-2-6-14-25)33-27(34)16-15-24-11-3-1-4-12-24/h1,3-4,11-12,15-16,25-26,30-31H,2,5-10,13-14,17-23,29H2,(H,32,35)(H,33,34)/b16-15+/t26-/m0/s1
Standard InChI Key: JLHNNIALZUDMPM-OXVFXORMSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
7.5570 -25.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2647 -25.3618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8492 -25.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1415 -25.7704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1415 -26.5876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4297 -26.9962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8492 -26.9962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8492 -24.5446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1415 -24.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9724 -25.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6801 -25.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3878 -25.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0955 -25.3618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8032 -25.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5109 -25.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2186 -25.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9263 -25.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6340 -25.7704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3417 -25.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0536 -25.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7572 -25.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4649 -25.7704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5570 -26.5876 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1392 -23.3179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4356 -22.9094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7255 -23.3145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7235 -24.1326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4317 -24.5457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7230 -26.5858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0143 -26.9926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3099 -26.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6016 -26.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5991 -27.8016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3108 -28.2118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0161 -27.8033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
5 7 2 0
3 8 1 1
8 9 1 0
2 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
1 23 2 0
9 24 1 0
9 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
6 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.72Molecular Weight (Monoisotopic): 485.3730AlogP: 2.97#Rotatable Bonds: 18Polar Surface Area: 108.28Molecular Species: BASEHBA: 5HBD: 5#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.67CX Basic pKa: 10.79CX LogP: 2.31CX LogD: -4.19Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.16Np Likeness Score: -0.03
References 1. Kachel HS, Franzyk H, Mellor IR.. (2019) Philanthotoxin Analogues That Selectively Inhibit Ganglionic Nicotinic Acetylcholine Receptors with Exceptional Potency., 62 (13): [PMID:31244109 ] [10.1021/acs.jmedchem.9b00519 ]