(3S)-3-acetamido-4-[[(2S)-2-carboxy-3-[1-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]carbamoyl]cyclopentyl]propyl]amino]-4-oxobutanoic acid

ID: ALA4462603

PubChem CID: 132451821

Max Phase: Preclinical

Molecular Formula: C25H33N3O10

Molecular Weight: 535.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](CC(=O)O)C(=O)NC[C@H](CC1(C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)O)CCCC1)C(=O)O

Standard InChI:  InChI=1S/C25H33N3O10/c1-14(29)27-18(11-20(31)32)21(33)26-13-16(22(34)35)12-25(8-2-3-9-25)24(38)28-19(23(36)37)10-15-4-6-17(30)7-5-15/h4-7,16,18-19,30H,2-3,8-13H2,1H3,(H,26,33)(H,27,29)(H,28,38)(H,31,32)(H,34,35)(H,36,37)/t16-,18-,19-/m0/s1

Standard InChI Key:  ZQIWHIVXBQEYTN-WDSOQIARSA-N

Molfile:  

 
     RDKit          2D

 38 39  0  0  0  0  0  0  0  0999 V2000
   31.2084   -5.0889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.4965   -5.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7847   -5.0889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4965   -6.3188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.7847   -4.2676    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0729   -5.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2084   -4.2676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9202   -3.8548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9202   -3.0335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6320   -2.6249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.2084   -2.6249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.6320   -4.2676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6320   -5.0889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9688   -5.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2213   -6.3491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0427   -6.3491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2992   -5.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3398   -4.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0520   -5.0726    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3305   -3.8466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7592   -4.6520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4756   -5.0567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1828   -4.6360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.4848   -5.8779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7500   -3.8307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4572   -3.4141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1723   -3.8174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8790   -3.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8702   -2.5794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1488   -2.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4451   -2.5971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5768   -2.1578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0729   -3.8548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0729   -3.0335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3610   -4.2676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0729   -6.3188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3610   -6.7315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.7847   -6.7315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  3  5  1  6
  3  6  1  0
  1  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
  8 12  1  1
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 13 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 21 25  1  1
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 29 32  1  0
  5 33  1  0
 33 34  2  0
 33 35  1  0
  6 36  1  0
 36 37  1  0
 36 38  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4462603

    ---

Associated Targets(Human)

ACE Tclin Angiotensin-converting enzyme (1423 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 535.55Molecular Weight (Monoisotopic): 535.2166AlogP: 0.25#Rotatable Bonds: 14
Polar Surface Area: 219.43Molecular Species: ACIDHBA: 7HBD: 7
#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 7#RO5 Violations (Lipinski): 3
CX Acidic pKa: 3.40CX Basic pKa: 4.14CX LogP: 0.18CX LogD: -9.39
Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.17Np Likeness Score: 0.33

References

1. Sharma U, Cozier GE, Sturrock ED, Acharya KR..  (2020)  Molecular Basis for Omapatrilat and Sampatrilat Binding to Neprilysin-Implications for Dual Inhibitor Design with Angiotensin-Converting Enzyme.,  63  (10): [PMID:32337993] [10.1021/acs.jmedchem.0c00441]

Source