The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Benzyl ((S)-1-(((S)-1-(benzylamino)-5-methyl-1,2-dioxohexan-3-yl)amino)-4-methyl-1-oxopentan-2-yl)carbamate ID: ALA4462651
PubChem CID: 155529142
Max Phase: Preclinical
Molecular Formula: C28H37N3O5
Molecular Weight: 495.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)C(=O)NCc1ccccc1
Standard InChI: InChI=1S/C28H37N3O5/c1-19(2)15-23(25(32)27(34)29-17-21-11-7-5-8-12-21)30-26(33)24(16-20(3)4)31-28(35)36-18-22-13-9-6-10-14-22/h5-14,19-20,23-24H,15-18H2,1-4H3,(H,29,34)(H,30,33)(H,31,35)/t23-,24-/m0/s1
Standard InChI Key: AQZNJQUJGGDAAI-ZEQRLZLVSA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
17.5709 -9.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2854 -8.8208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8565 -8.8208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5709 -10.0584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8565 -7.9959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1420 -7.5834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1450 -6.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4314 -6.3449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7159 -6.7574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7185 -7.5867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4328 -7.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9990 -9.2341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7143 -8.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0524 -10.0703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4289 -9.2334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7143 -7.9959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1433 -8.8215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8578 -9.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5723 -8.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2868 -9.2334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5723 -7.9959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0012 -8.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7157 -9.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7141 -10.0595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4276 -10.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1431 -10.0594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1405 -9.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4262 -8.8213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7965 -10.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8754 -11.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4684 -9.9308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8578 -10.0584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4352 -8.0496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9129 -7.4110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2047 -6.6394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0987 -7.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
3 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
2 12 1 0
12 13 1 0
12 14 1 6
13 15 1 0
13 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
14 29 1 0
29 30 1 0
29 31 1 0
18 32 2 0
17 33 1 1
33 34 1 0
34 35 1 0
34 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.62Molecular Weight (Monoisotopic): 495.2733AlogP: 3.74#Rotatable Bonds: 13Polar Surface Area: 113.60Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.21CX Basic pKa: ┄CX LogP: 4.99CX LogD: 4.99Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -0.38
References 1. Pacifico S, Ferretti V, Albanese V, Fantinati A, Gallerani E, Nicoli F, Gavioli R, Zamberlan F, Preti D, Marastoni M.. (2019) Synthesis and Biological Activity of Peptide α-Ketoamide Derivatives as Proteasome Inhibitors., 10 (7): [PMID:31312413 ] [10.1021/acsmedchemlett.9b00233 ]