Benzyl ((S)-1-(((S)-1-(benzylamino)-5-methyl-1,2-dioxohexan-3-yl)amino)-4-methyl-1-oxopentan-2-yl)carbamate

ID: ALA4462651

PubChem CID: 155529142

Max Phase: Preclinical

Molecular Formula: C28H37N3O5

Molecular Weight: 495.62

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)C(=O)NCc1ccccc1

Standard InChI:  InChI=1S/C28H37N3O5/c1-19(2)15-23(25(32)27(34)29-17-21-11-7-5-8-12-21)30-26(33)24(16-20(3)4)31-28(35)36-18-22-13-9-6-10-14-22/h5-14,19-20,23-24H,15-18H2,1-4H3,(H,29,34)(H,30,33)(H,31,35)/t23-,24-/m0/s1

Standard InChI Key:  AQZNJQUJGGDAAI-ZEQRLZLVSA-N

Molfile:  

 
     RDKit          2D

 36 37  0  0  0  0  0  0  0  0999 V2000
   17.5709   -9.2334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2854   -8.8208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8565   -8.8208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5709  -10.0584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8565   -7.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1420   -7.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1450   -6.7573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4314   -6.3449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7159   -6.7574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7185   -7.5867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4328   -7.9954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9990   -9.2341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7143   -8.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0524  -10.0703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4289   -9.2334    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7143   -7.9959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1433   -8.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8578   -9.2334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5723   -8.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2868   -9.2334    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5723   -7.9959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0012   -8.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7157   -9.2334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7141  -10.0595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4276  -10.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1431  -10.0594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1405   -9.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4262   -8.8213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7965  -10.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8754  -11.2309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4684   -9.9308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8578  -10.0584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4352   -8.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9129   -7.4110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2047   -6.6394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0987   -7.5441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  2 12  1  0
 12 13  1  0
 12 14  1  6
 13 15  1  0
 13 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 14 29  1  0
 29 30  1  0
 29 31  1  0
 18 32  2  0
 17 33  1  1
 33 34  1  0
 34 35  1  0
 34 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4462651

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 495.62

Molecular Weight (Monoisotopic): 495.2733

AlogP: 3.74

#Rotatable Bonds: 13

Polar Surface Area: 113.60

Molecular Species: NEUTRAL

HBA: 5

HBD: 3

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): 3

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 12.21

CX Basic pKa: ┄

CX LogP: 4.99

CX LogD: 4.99

Aromatic Rings: 2

Heavy Atoms: 36

QED Weighted: 0.37

Np Likeness Score: -0.38

References

1. Pacifico S, Ferretti V, Albanese V, Fantinati A, Gallerani E, Nicoli F, Gavioli R, Zamberlan F, Preti D, Marastoni M..  (2019)  Synthesis and Biological Activity of Peptide α-Ketoamide Derivatives as Proteasome Inhibitors.,  10  (7): [PMID:31312413] [10.1021/acsmedchemlett.9b00233]

Source

Source(1):

• Scientific Literature