The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
allyl 5-oxo-4,4-dipropyltetrahydrofuran-3-ylcarbamate ID: ALA4462831
PubChem CID: 9881876
Max Phase: Preclinical
Molecular Formula: C14H23NO4
Molecular Weight: 269.34
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CCOC(=O)NC1COC(=O)C1(CCC)CCC
Standard InChI: InChI=1S/C14H23NO4/c1-4-7-14(8-5-2)11(10-19-12(14)16)15-13(17)18-9-6-3/h6,11H,3-5,7-10H2,1-2H3,(H,15,17)
Standard InChI Key: LFSMEOQQQLQKKA-UHFFFAOYSA-N
Molfile:
RDKit 2D
19 19 0 0 0 0 0 0 0 0999 V2000
14.2746 -11.4081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0621 -12.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8612 -11.9921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6270 -13.4719 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3040 -12.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2387 -12.1941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9688 -12.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0834 -13.2697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7668 -11.5175 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4458 -12.5741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2422 -12.3588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0710 -11.1927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2828 -10.3954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9448 -11.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4728 -10.9114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5948 -12.3350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8228 -10.1643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3507 -9.4876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7007 -8.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 2 1 0
2 6 1 0
6 7 1 0
7 4 1 0
5 8 2 0
6 9 1 0
3 10 1 0
10 11 1 0
1 12 1 0
12 13 1 0
9 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 1 0
18 19 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 269.34Molecular Weight (Monoisotopic): 269.1627AlogP: 2.41#Rotatable Bonds: 7Polar Surface Area: 64.63Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.17CX LogD: 3.17Aromatic Rings: ┄Heavy Atoms: 19QED Weighted: 0.57Np Likeness Score: 0.50
References 1. Husain A, Khan SA, Iram F, Iqbal MA, Asif M.. (2019) Insights into the chemistry and therapeutic potential of furanones: A versatile pharmacophore., 171 [PMID:30909021 ] [10.1016/j.ejmech.2019.03.021 ]