Urundeuvine D

ID: ALA4462944

PubChem CID: 155529581

Max Phase: Preclinical

Molecular Formula: C30H22O9

Molecular Weight: 526.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1c2ccc(O)cc2OC2c3cc(O)c(O)cc3[C@@H](c3ccc(O)cc3)[C@@H](C(=O)c3ccc(O)cc3O)C12

Standard InChI:  InChI=1S/C30H22O9/c31-14-3-1-13(2-4-14)25-19-11-22(35)23(36)12-20(19)30-27(29(38)18-8-6-16(33)10-24(18)39-30)26(25)28(37)17-7-5-15(32)9-21(17)34/h1-12,25-27,30-36H/t25-,26-,27?,30?/m1/s1

Standard InChI Key:  JOBIOJZSQZPGIK-XCMBPIBYSA-N

Molfile:  

 
     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
    5.8561   -6.0051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8561   -4.3707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5613   -4.7835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5579   -5.6006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2599   -6.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1508   -5.6006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1533   -4.7853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4496   -4.3772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7428   -4.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7442   -5.6018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4485   -6.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9672   -5.6030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0352   -4.3746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2669   -4.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9692   -4.7895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6766   -4.3883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6830   -3.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9760   -3.1613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2715   -3.5649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3931   -3.1690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8569   -6.8223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2576   -6.8271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9642   -7.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5488   -7.2337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7827   -5.6006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1907   -6.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0055   -6.3061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4121   -5.5981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9979   -4.8906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1845   -4.8961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9605   -8.0533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6662   -8.4638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3760   -8.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3757   -7.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6694   -6.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9791   -2.3441    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2512   -8.4591    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0831   -8.4668    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2293   -5.5947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  7  2  1  0
  6  1  1  0
  1  4  1  0
  3  2  1  0
  3  4  1  0
  3 14  1  0
  4  5  1  0
  5 12  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
 15 12  1  0
  9 13  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
  1 21  2  0
  5 22  1  1
 22 23  1  0
 22 24  2  0
 12 25  1  1
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 23 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 23  1  0
 18 36  1  0
 31 37  1  0
 33 38  1  0
 28 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4462944

    ---

Associated Targets(Human)

CTSV Tchem Cathepsin L2 (273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 526.50Molecular Weight (Monoisotopic): 526.1264AlogP: 4.50#Rotatable Bonds: 3
Polar Surface Area: 164.75Molecular Species: NEUTRALHBA: 9HBD: 6
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.50CX Basic pKa: CX LogP: 4.91CX LogD: 4.62
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.17Np Likeness Score: 1.15

References

1. Menezes JCJMDS, Diederich MF..  (2019)  Natural dimers of coumarin, chalcones, and resveratrol and the link between structure and pharmacology.,  182  [PMID:31494471] [10.1016/j.ejmech.2019.111637]

Source