The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Urundeuvine D ID: ALA4462944
PubChem CID: 155529581
Max Phase: Preclinical
Molecular Formula: C30H22O9
Molecular Weight: 526.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2ccc(O)cc2OC2c3cc(O)c(O)cc3[C@@H](c3ccc(O)cc3)[C@@H](C(=O)c3ccc(O)cc3O)C12
Standard InChI: InChI=1S/C30H22O9/c31-14-3-1-13(2-4-14)25-19-11-22(35)23(36)12-20(19)30-27(29(38)18-8-6-16(33)10-24(18)39-30)26(25)28(37)17-7-5-15(32)9-21(17)34/h1-12,25-27,30-36H/t25-,26-,27?,30?/m1/s1
Standard InChI Key: JOBIOJZSQZPGIK-XCMBPIBYSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
5.8561 -6.0051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8561 -4.3707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5613 -4.7835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5579 -5.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2599 -6.0100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1508 -5.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1533 -4.7853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4496 -4.3772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7428 -4.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7442 -5.6018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4485 -6.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9672 -5.6030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0352 -4.3746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2669 -4.3756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9692 -4.7895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6766 -4.3883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6830 -3.5734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9760 -3.1613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2715 -3.5649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3931 -3.1690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8569 -6.8223 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2576 -6.8271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9642 -7.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5488 -7.2337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7827 -5.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1907 -6.3081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0055 -6.3061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4121 -5.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9979 -4.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1845 -4.8961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9605 -8.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6662 -8.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3760 -8.0572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3757 -7.2357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6694 -6.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9791 -2.3441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2512 -8.4591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0831 -8.4668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2293 -5.5947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7 2 1 0
6 1 1 0
1 4 1 0
3 2 1 0
3 4 1 0
3 14 1 0
4 5 1 0
5 12 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
15 12 1 0
9 13 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
1 21 2 0
5 22 1 1
22 23 1 0
22 24 2 0
12 25 1 1
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
23 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 23 1 0
18 36 1 0
31 37 1 0
33 38 1 0
28 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.50Molecular Weight (Monoisotopic): 526.1264AlogP: 4.50#Rotatable Bonds: 3Polar Surface Area: 164.75Molecular Species: NEUTRALHBA: 9HBD: 6#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.50CX Basic pKa: ┄CX LogP: 4.91CX LogD: 4.62Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.17Np Likeness Score: 1.15
References 1. Menezes JCJMDS, Diederich MF.. (2019) Natural dimers of coumarin, chalcones, and resveratrol and the link between structure and pharmacology., 182 [PMID:31494471 ] [10.1016/j.ejmech.2019.111637 ]