The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(5-(2-Hydroxypropyl)-2,3-dimethoxyphenoxy)-3-methoxyphenyl)propan-2-ol ID: ALA4462994
PubChem CID: 155529486
Max Phase: Preclinical
Molecular Formula: C21H28O6
Molecular Weight: 376.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CC(C)O)ccc1Oc1cc(CC(C)O)cc(OC)c1OC
Standard InChI: InChI=1S/C21H28O6/c1-13(22)8-15-6-7-17(18(10-15)24-3)27-20-12-16(9-14(2)23)11-19(25-4)21(20)26-5/h6-7,10-14,22-23H,8-9H2,1-5H3
Standard InChI Key: BMGFPMOVVJSUPC-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
3.6027 -12.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6016 -12.8730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3163 -13.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0328 -12.8725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0300 -12.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3145 -11.6329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7428 -11.6268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4589 -12.0366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4586 -12.8593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1737 -13.2691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8877 -12.8537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8819 -12.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1662 -11.6185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1588 -10.7935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8695 -10.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3121 -10.8079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8881 -11.6334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8879 -10.8084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3161 -14.1109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6016 -14.5232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6042 -13.2626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6084 -14.0876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6013 -15.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3250 -14.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0253 -10.3933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8961 -14.5037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8872 -14.1105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
13 14 1 0
14 15 1 0
6 16 1 0
1 17 1 0
17 18 1 0
3 19 1 0
19 20 1 0
11 21 1 0
21 22 1 0
20 23 1 0
22 24 1 0
16 25 1 0
22 26 1 0
20 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 376.45Molecular Weight (Monoisotopic): 376.1886AlogP: 3.35#Rotatable Bonds: 9Polar Surface Area: 77.38Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.88CX LogD: 2.88Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.70Np Likeness Score: 0.52
References 1. Ferreira DD, Sousa FS, Costa-Silva TA, Reimão JQ, Torrecilhas AC, Johns DM, Sear CE, Honorio KM, Lago JHG, Anderson EA, Tempone AG, Tempone AG.. (2019) Dehydrodieugenol B derivatives as antiparasitic agents: Synthesis and biological activity against Trypanosoma cruzi., 176 [PMID:31103897 ] [10.1016/j.ejmech.2019.05.001 ]