(E)-6-(4-Methoxyphenyl)imidazo[2,1-b]thiazole-5-carbaldehyde O-(3,4-dichlorobenzyl)oxime

ID: ALA4463067

PubChem CID: 142505480

Max Phase: Preclinical

Molecular Formula: C20H15Cl2N3O2S

Molecular Weight: 432.33

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2nc3sccn3c2/C=N/OCc2ccc(Cl)c(Cl)c2)cc1

Standard InChI:  InChI=1S/C20H15Cl2N3O2S/c1-26-15-5-3-14(4-6-15)19-18(25-8-9-28-20(25)24-19)11-23-27-12-13-2-7-16(21)17(22)10-13/h2-11H,12H2,1H3/b23-11+

Standard InChI Key:  VFSYNQQGMHIFPI-FOKLQQMPSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   14.9001  -14.0121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8844  -12.6899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4121  -13.3567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6646  -12.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6697  -13.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4481  -13.9976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9241  -13.3338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4398  -12.6761    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.6577  -14.7925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8606  -14.9728    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6182  -15.7532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8211  -15.9334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5787  -16.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7828  -16.8921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5402  -17.6717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0951  -18.2728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8957  -18.0891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1345  -17.3097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8537  -19.0535    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.7431  -17.8515    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   13.5973  -13.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1809  -12.6635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3645  -12.6728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9635  -13.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3849  -14.0910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1999  -14.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1464  -13.3966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7285  -12.6944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  5  1  0
  4  2  2  0
  2  3  1  0
  3  1  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  4  1  0
  1  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 16 19  1  0
 15 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
  3 21  1  0
 24 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4463067

    ---

Associated Targets(Human)

NR1I3 Tchem Nuclear receptor subfamily 1 group I member 3 (655 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.33Molecular Weight (Monoisotopic): 431.0262AlogP: 5.93#Rotatable Bonds: 6
Polar Surface Area: 48.12Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.60CX LogP: 5.62CX LogD: 5.62
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.28Np Likeness Score: -1.75

References

1. Liang D, Li L, Lynch C, Diethelm-Varela B, Xia M, Xue F, Wang H..  (2019)  DL5050, a Selective Agonist for the Human Constitutive Androstane Receptor.,  10  (7): [PMID:31312405] [10.1021/acsmedchemlett.9b00079]

Source