Quinovic acid

ID: ALA4463264

Cas Number: 465-74-7

PubChem CID: 120678

Product Number: Q695625, Order Now?

Max Phase: Preclinical

Molecular Formula: C30H46O5

Molecular Weight: 486.69

Molecule Type: Unknown

Associated Items:

This product is currently unavailable

Names and Identifiers

Canonical SMILES:  C[C@H]1[C@H](C)CC[C@]2(C(=O)O)CC[C@]3(C(=O)O)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@H]12

Standard InChI:  InChI=1S/C30H46O5/c1-17-9-14-29(24(32)33)15-16-30(25(34)35)19(23(29)18(17)2)7-8-21-27(5)12-11-22(31)26(3,4)20(27)10-13-28(21,30)6/h7,17-18,20-23,31H,8-16H2,1-6H3,(H,32,33)(H,34,35)/t17-,18+,20+,21-,22+,23+,27+,28-,29+,30-/m1/s1

Standard InChI Key:  OJUYFGQEMPENCE-DPKHZRJYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   17.9470   -3.5911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7804   -8.0186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3726   -7.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9645   -8.0160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6753   -3.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7958   -4.8352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5110   -4.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2263   -4.8352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2227   -5.6633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9347   -6.0802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6547   -5.6693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5110   -6.0753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7958   -5.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8022   -7.3082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5173   -6.8968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0869   -6.9004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0896   -6.0746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3792   -5.6595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6657   -6.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9417   -4.4241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6582   -4.8461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3761   -4.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3877   -3.6109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6607   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0842   -5.2431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5032   -5.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2147   -6.4872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3660   -5.2597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0841   -4.8442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3654   -6.0877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9489   -7.2995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3685   -6.4872    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.7916   -6.4872    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.9346   -5.2472    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.6877   -2.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9242   -6.9061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9983   -7.2821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2377   -3.1722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  3  4  1  0
  6 13  1  0
  6  7  1  0
 12  9  1  0
  8  7  2  0
  8  9  1  0
  8 20  1  0
  9 10  1  0
 10 11  1  0
 11 21  1  0
 12 13  1  0
 12 15  1  0
 13 17  1  0
 16 14  1  0
 14 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 24  1  0
 20 21  1  0
 20  1  1  0
 21 22  1  0
 22 23  1  0
 23  5  1  0
  5  1  1  0
 17 25  1  1
 12 26  1  1
  9 27  1  6
 21 28  1  1
 28 29  2  0
 28 30  1  0
 24  3  1  0
 16  3  1  0
 24 31  1  1
 16 32  1  6
 13 33  1  6
 20 34  1  1
  5 35  1  6
 27 36  1  0
 27 37  2  0
  1 38  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4463264

    Quinovic acid

Associated Targets(non-human)

Haemophilus influenzae (8812 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 486.69Molecular Weight (Monoisotopic): 486.3345AlogP: 6.15#Rotatable Bonds: 2
Polar Surface Area: 94.83Molecular Species: ACIDHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.23CX Basic pKa: CX LogP: 5.77CX LogD: 0.25
Aromatic Rings: Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: 2.94

References

1. Kezetas Bankeu JJ, Kenou Kagho DU, Fotsing Fongang YS, Kouipou Toghueo RM, Mba'ning BM, Tchouya Feuya GR, Boyom Fekam F, Tchouankeu JC, Ngouela SA, Sewald N, Lenta BN, Ali MS..  (2019)  Constituents from Nauclea latifolia with Anti-Haemophilus influenzae Type b Inhibitory Activities.,  82  (9): [PMID:31429278] [10.1021/acs.jnatprod.9b00463]

Source