The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3S,4R,5R)-2-(Hydroxymethyl)-5-(6-(4-(4-(6-(trifluoromethyl)-pyridin-3-yl)phenyl)piperazin-1-yl)-9H-purin-9-yl)tetrahydrofuran-3,4-diol ID: ALA4463459
PubChem CID: 155530232
Max Phase: Preclinical
Molecular Formula: C26H26F3N7O4
Molecular Weight: 557.53
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: OC[C@H]1O[C@@H](n2cnc3c(N4CCN(c5ccc(-c6ccc(C(F)(F)F)nc6)cc5)CC4)ncnc32)[C@H](O)[C@@H]1O
Standard InChI: InChI=1S/C26H26F3N7O4/c27-26(28,29)19-6-3-16(11-30-19)15-1-4-17(5-2-15)34-7-9-35(10-8-34)23-20-24(32-13-31-23)36(14-33-20)25-22(39)21(38)18(12-37)40-25/h1-6,11,13-14,18,21-22,25,37-39H,7-10,12H2/t18-,21-,22-,25-/m1/s1
Standard InChI Key: RFEMNVLOTXZLKM-PXOHRUDZSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
14.1926 -11.8081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2031 -10.4846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7201 -11.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9805 -10.7447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9673 -11.5664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6684 -11.9863 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3871 -11.5892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4004 -10.7675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6948 -10.3430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7068 -9.5259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4274 -9.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4413 -8.3160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7416 -7.8932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0262 -8.2901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0105 -9.1098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9298 -12.5857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1498 -12.8295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1406 -13.6466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9149 -13.9079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4026 -13.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2197 -13.2614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1587 -14.6879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4741 -14.1194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7313 -13.7786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7550 -7.0775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4717 -6.6827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4872 -5.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7866 -5.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0690 -5.8438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0571 -6.6588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8018 -4.6297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5180 -4.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5324 -3.4176 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8313 -2.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1142 -3.3969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1034 -4.2119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8442 -2.1790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5583 -1.7817 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.1431 -1.7593 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.8362 -1.3909 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 5 1 0
4 2 1 0
2 3 2 0
3 1 1 0
4 5 2 0
4 9 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 16 1 0
16 1 1 1
20 21 1 6
19 22 1 6
18 23 1 1
23 24 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
13 25 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
28 31 1 0
34 37 1 0
37 38 1 0
37 39 1 0
37 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 557.53Molecular Weight (Monoisotopic): 557.1998AlogP: 1.85#Rotatable Bonds: 5Polar Surface Area: 132.89Molecular Species: NEUTRALHBA: 11HBD: 3#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.45CX Basic pKa: 4.53CX LogP: 2.28CX LogD: 2.28Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.33Np Likeness Score: -0.34
References 1. Crespo RA, Dang Q, Zhou NE, Guthrie LM, Snavely TC, Dong W, Loesch KA, Suzuki T, You L, Wang W, O'Malley T, Parish T, Olsen DB, Sacchettini JC.. (2019) Structure-Guided Drug Design of 6-Substituted Adenosine Analogues as Potent Inhibitors of Mycobacterium tuberculosis Adenosine Kinase., 62 (9): [PMID:31002508 ] [10.1021/acs.jmedchem.9b00020 ]