The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Taichunin C ID: ALA4463468
PubChem CID: 155529852
Max Phase: Preclinical
Molecular Formula: C25H36O10
Molecular Weight: 496.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C[C@@]1(C)CCC2=C(C(=O)O[C@]23CCCC(C)(C)[C@@H]3C(=O)O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O
Standard InChI: InChI=1S/C25H36O10/c1-5-24(4)10-7-12-14(19(24)30)20(31)35-25(12)9-6-8-23(2,3)18(25)21(32)34-22-17(29)16(28)15(27)13(11-26)33-22/h5,13,15-19,22,26-30H,1,6-11H2,2-4H3/t13-,15-,16+,17-,18+,19+,22+,24+,25-/m1/s1
Standard InChI Key: IFADJUITQGOIEZ-ISLOUNIRSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
5.1088 -17.7879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0904 -16.9697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3734 -16.5777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6747 -17.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3550 -15.7596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6380 -15.3676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0537 -15.3334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0334 -14.5188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7707 -15.7254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7891 -16.5436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4674 -15.3028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1845 -15.6948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3228 -17.5991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9137 -18.3162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7402 -18.3091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8333 -18.7885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5875 -19.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4953 -18.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2591 -19.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7523 -20.5275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5650 -20.4397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4090 -19.0191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8984 -19.6770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2346 -20.4233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0490 -20.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5076 -19.1290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2100 -19.5384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9151 -19.1332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2084 -17.9110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5022 -18.3187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6009 -20.9465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1535 -19.0194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4038 -18.2011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6934 -17.7971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6227 -19.5419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 6
3 5 1 0
5 6 1 1
5 7 1 0
7 8 1 6
7 9 1 0
9 10 1 0
9 11 1 1
11 12 1 0
2 10 1 0
14 13 1 1
15 14 1 0
17 16 1 0
18 17 1 0
17 19 1 0
17 22 1 0
19 20 1 0
20 21 1 0
23 21 1 6
22 23 1 0
26 23 1 0
23 24 1 0
24 25 1 0
25 27 1 0
26 27 2 0
26 30 1 0
27 28 1 0
28 14 1 0
14 29 1 0
29 30 1 0
25 31 2 0
15 32 2 0
22 33 1 6
33 1 1 0
33 34 2 0
28 35 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.55Molecular Weight (Monoisotopic): 496.2308AlogP: 0.09#Rotatable Bonds: 4Polar Surface Area: 162.98Molecular Species: NEUTRALHBA: 10HBD: 5#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.18CX Basic pKa: ┄CX LogP: 0.67CX LogD: 0.67Aromatic Rings: ┄Heavy Atoms: 35QED Weighted: 0.27Np Likeness Score: 2.53
References 1. Kato H, Sebe M, Nagaki M, Eguchi K, Kagiyama I, Hitora Y, Frisvad JC, Williams RM, Tsukamoto S.. (2019) Taichunins A-D, Norditerpenes from Aspergillus taichungensis (IBT 19404)., 82 (5): [PMID:30995043 ] [10.1021/acs.jnatprod.8b01032 ]