Schwarzinicine C

ID: ALA4463554

PubChem CID: 155529898

Max Phase: Preclinical

Molecular Formula: C29H35NO6

Molecular Weight: 493.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CCC(Cc2ccc(OC)c(OC)c2)NCCc2ccc3c(c2)OCO3)cc1OC

Standard InChI:  InChI=1S/C29H35NO6/c1-31-24-10-6-20(16-27(24)33-3)5-9-23(15-22-8-11-25(32-2)28(18-22)34-4)30-14-13-21-7-12-26-29(17-21)36-19-35-26/h6-8,10-12,16-18,23,30H,5,9,13-15,19H2,1-4H3

Standard InChI Key:  PKMRIAOXVIBRBZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   20.9001   -6.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6081   -6.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3123   -6.8476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3123   -7.6670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6107   -8.0736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9001   -7.6682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1879   -8.0800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1879   -8.8953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0245   -8.0747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7326   -7.6670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4407   -8.0747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1487   -7.6670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8609   -8.0747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5692   -7.6673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2737   -8.0741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2737   -8.8939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5718   -9.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8609   -8.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9859   -9.3016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6940   -8.8939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9859   -7.6665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.9859   -6.8470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7326   -6.8476    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.4407   -6.4358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4407   -5.6205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1487   -5.2087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1491   -4.3891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8588   -3.9842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5671   -4.3920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5694   -5.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8653   -5.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1770   -3.8441    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.8413   -3.0966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0279   -3.1818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1879   -6.4364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4799   -6.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  4  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 13 18  1  0
 16 19  1  0
 19 20  1  0
 15 21  1  0
 21 22  1  0
 10 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 29 32  1  0
 33 32  1  0
 34 33  1  0
 28 34  1  0
  1 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4463554

    ---

Associated Targets(non-human)

Aorta (2975 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.60Molecular Weight (Monoisotopic): 493.2464AlogP: 4.83#Rotatable Bonds: 13
Polar Surface Area: 67.41Molecular Species: BASEHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.47CX LogP: 5.34CX LogD: 2.50
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: 0.21

References

1. Krishnan P, Lee FK, Yap VA, Low YY, Kam TS, Yong KT, Ting KN, Lim KH..  (2020)  Schwarzinicines A-G, 1,4-Diarylbutanoid-Phenethylamine Conjugates from the Leaves of Ficus schwarzii.,  83  (1): [PMID:31935094] [10.1021/acs.jnatprod.9b01160]

Source