N-(4-Chlorophenyl)-7-((2,4-difluorophenyl)sulfonyl)-5,6,7,8-tetrahydropyrido[4',3':4,5]thieno[2,3-d]pyrimidin-4-amine

ID: ALA4463661

PubChem CID: 155530181

Max Phase: Preclinical

Molecular Formula: C21H15ClF2N4O2S2

Molecular Weight: 492.96

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=S(=O)(c1ccc(F)cc1F)N1CCc2c(sc3ncnc(Nc4ccc(Cl)cc4)c23)C1

Standard InChI:  InChI=1S/C21H15ClF2N4O2S2/c22-12-1-4-14(5-2-12)27-20-19-15-7-8-28(10-17(15)31-21(19)26-11-25-20)32(29,30)18-6-3-13(23)9-16(18)24/h1-6,9,11H,7-8,10H2,(H,25,26,27)

Standard InChI Key:  DHSYELGFVCMALV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   21.3790   -5.4933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3832   -4.6762    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.6734   -5.0812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0125   -2.6455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0114   -3.4651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7194   -3.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4291   -3.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4262   -2.6419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7176   -2.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3033   -3.8731    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.3027   -4.6903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3015   -6.3232    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0118   -5.9107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0093   -5.0957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.5935   -5.9132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5904   -5.0972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8185   -6.1682    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.3363   -5.5100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8148   -4.8525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4866   -4.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6788   -4.0256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2005   -4.6827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5295   -5.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9795   -3.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3963   -3.2630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9932   -2.5530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1751   -2.5471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7619   -3.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1674   -3.9640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2134   -3.2705    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.7704   -1.8371    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.1324   -2.2307    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  5 10  1  0
 10 11  1  0
 11 16  2  0
 15 12  2  0
 12 13  1  0
 13 14  2  0
 14 11  1  0
 15 16  1  0
 16 19  1  0
 18 17  1  0
 17 15  1  0
 18 19  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22  2  1  0
  2 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 25 30  1  0
 27 31  1  0
  8 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4463661

    ---

Associated Targets(Human)

SUNE1 (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MKNK1 Tchem MAP kinase-interacting serine/threonine-protein kinase MNK1 (2071 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
786-0 (47912 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 492.96Molecular Weight (Monoisotopic): 492.0293AlogP: 5.11#Rotatable Bonds: 4
Polar Surface Area: 75.19Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.54CX LogP: 5.17CX LogD: 5.17
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -2.50

References

1. Zhang M, Jiang L, Tao J, Pan Z, He M, Su D, He G, Jiang Q..  (2019)  Design, synthesis and biological evaluation of 4-aniline-thieno[2,3-d]pyrimidine derivatives as MNK1 inhibitors against renal cell carcinoma and nasopharyngeal carcinoma.,  27  (11): [PMID:31014565] [10.1016/j.bmc.2019.04.022]

Source