3-bromo-N'-((5-(pyridin-2-ylthio)furan-2-yl)methylene)benzohydrazide

ID: ALA4463681

PubChem CID: 56687639

Max Phase: Preclinical

Molecular Formula: C17H12BrN3O2S

Molecular Weight: 402.27

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(N/N=C/c1ccc(Sc2ccccn2)o1)c1cccc(Br)c1

Standard InChI:  InChI=1S/C17H12BrN3O2S/c18-13-5-3-4-12(10-13)17(22)21-20-11-14-7-8-16(23-14)24-15-6-1-2-9-19-15/h1-11H,(H,21,22)/b20-11+

Standard InChI Key:  IREZQEIPLSGOCU-RGVLZGJSSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   35.2919   -8.5805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1091   -8.5805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3635   -7.8038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7005   -7.3217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0418   -7.8038    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.8107   -9.2410    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   35.1421   -9.9880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6591  -10.6484    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9899  -11.3948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8033  -11.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2849  -10.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9515  -10.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6992   -6.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9909   -6.0970    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9897   -5.2798    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.2813   -4.8723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2801   -4.0551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5743   -5.2820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.9873   -3.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9864   -2.8314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2775   -2.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5681   -2.8371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5725   -3.6522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6937   -2.4220    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  1  0
  1  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  4 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 17  1  0
 20 24  1  0
M  END

Associated Targets(Human)

EYA2 Tbio Eyes absent homolog 2 (5884 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 402.27Molecular Weight (Monoisotopic): 400.9834AlogP: 4.35#Rotatable Bonds: 5
Polar Surface Area: 67.49Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.29CX Basic pKa: 2.24CX LogP: 4.45CX LogD: 4.45
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.51Np Likeness Score: -2.06

References

1.  (2012)  Inhibitors of eya2, 

Source