4-(4-Decylpiperazine-1-carboxamido)-2-fluorophenyl sulfamate

ID: ALA4463695

PubChem CID: 155529978

Max Phase: Preclinical

Molecular Formula: C21H35FN4O4S

Molecular Weight: 458.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCN1CCN(C(=O)Nc2ccc(OS(N)(=O)=O)c(F)c2)CC1

Standard InChI:  InChI=1S/C21H35FN4O4S/c1-2-3-4-5-6-7-8-9-12-25-13-15-26(16-14-25)21(27)24-18-10-11-20(19(22)17-18)30-31(23,28)29/h10-11,17H,2-9,12-16H2,1H3,(H,24,27)(H2,23,28,29)

Standard InChI Key:  WQEKSOBELLOZSK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 32  0  0  0  0  0  0  0  0999 V2000
   30.4053   -2.6125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.0008   -1.9068    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   29.5919   -2.6099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1723   -1.9191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1711   -2.7387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8792   -3.1476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5888   -2.7382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5860   -1.9155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8774   -1.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4631   -3.1467    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7557   -2.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0477   -3.1456    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7563   -1.9203    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.3430   -2.7311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6371   -3.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6323   -3.9532    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.3395   -4.3646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0516   -3.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2922   -1.5043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.7076   -1.4989    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.9227   -4.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8749   -0.6931    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.9189   -5.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6248   -5.5876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3344   -5.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0402   -5.5941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7498   -5.1887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4556   -5.6005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1652   -5.1952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8710   -5.6070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5806   -5.2017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  5 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 12 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
  8 19  1  0
 19  2  1  0
  2 20  1  0
 16 21  1  0
  9 22  1  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4463695

    ---

Associated Targets(Human)

STS Tchem Steryl-sulfatase (1865 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.60Molecular Weight (Monoisotopic): 458.2363AlogP: 3.70#Rotatable Bonds: 12
Polar Surface Area: 104.97Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 10.23CX Basic pKa: 7.62CX LogP: 3.95CX LogD: 3.53
Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.46Np Likeness Score: -1.54

References

1. Moi D, Foster PA, Rimmer LG, Jaffri A, Deplano A, Balboni G, Onnis V, Potter BVL..  (2019)  Synthesis and in vitro evaluation of piperazinyl-ureido sulfamates as steroid sulfatase inhibitors.,  182  [PMID:31422224] [10.1016/j.ejmech.2019.111614]

Source