The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl 3-(2-(7-(hydroxyamino)-7-oxoheptanamido)thiazol-4-yl)phenylcarbamate ID: ALA4464421
PubChem CID: 155530597
Max Phase: Preclinical
Molecular Formula: C19H24N4O5S
Molecular Weight: 420.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)Nc1cccc(-c2csc(NC(=O)CCCCCC(=O)NO)n2)c1
Standard InChI: InChI=1S/C19H24N4O5S/c1-2-28-19(26)20-14-8-6-7-13(11-14)15-12-29-18(21-15)22-16(24)9-4-3-5-10-17(25)23-27/h6-8,11-12,27H,2-5,9-10H2,1H3,(H,20,26)(H,23,25)(H,21,22,24)
Standard InChI Key: LISXISRRNAENFL-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
33.5759 -10.7074 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2851 -11.1133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9913 -10.7021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2882 -11.9305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.7005 -11.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4067 -10.6967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1159 -11.1027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8221 -10.6914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5313 -11.0973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2375 -10.6861 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5344 -11.9145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.9467 -11.0920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.8697 -11.1187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1226 -10.7900 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5780 -11.3993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9893 -12.1055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7880 -11.9325 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.5385 -12.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3539 -12.1036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7608 -11.3991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3535 -10.6930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5349 -10.6958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1317 -11.4009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1237 -9.9897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5296 -9.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1183 -8.5743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3468 -9.2774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5243 -7.8650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1130 -7.1589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
1 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
20 15 1 0
22 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.49Molecular Weight (Monoisotopic): 420.1467AlogP: 3.77#Rotatable Bonds: 10Polar Surface Area: 129.65Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.92CX Basic pKa: ┄CX LogP: 3.15CX LogD: 3.04Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.26Np Likeness Score: -1.52
References 1. Amin SA, Adhikari N, Kotagiri S, Jha T, Ghosh B.. (2019) Histone deacetylase 3 inhibitors in learning and memory processes with special emphasis on benzamides., 166 [PMID:30735902 ] [10.1016/j.ejmech.2019.01.077 ]