The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Bipolaricin E ID: ALA4464450
PubChem CID: 155530437
Max Phase: Preclinical
Molecular Formula: C25H40O3
Molecular Weight: 388.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)=C[C@H]1C[C@H](C)[C@]2(CC[C@]3(C)C[C@H]4[C@H](CC[C@@]4(C)O)/C(CO)=C\C[C@H]32)O1
Standard InChI: InChI=1S/C25H40O3/c1-16(2)12-19-13-17(3)25(28-19)11-10-23(4)14-21-20(8-9-24(21,5)27)18(15-26)6-7-22(23)25/h6,12,17,19-22,26-27H,7-11,13-15H2,1-5H3/b18-6-/t17-,19-,20+,21-,22+,23+,24+,25-/m0/s1
Standard InChI Key: WPXFKHCSNMMBKO-YSCFQODBSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
17.1197 -16.1086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4140 -15.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4130 -16.5155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9607 -13.3257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7490 -13.1111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7885 -12.2950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0246 -12.0052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5131 -12.6422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2071 -13.5794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7863 -13.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6059 -14.9742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6059 -13.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1810 -13.5794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1802 -14.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9587 -14.6522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4408 -13.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4521 -13.2666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8037 -13.7641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7864 -14.9742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2071 -14.3979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4800 -14.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6098 -15.5775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1722 -15.2130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3633 -15.5514 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.6968 -12.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4721 -11.8472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7583 -14.1564 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
21.2017 -12.2153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8853 -11.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2477 -13.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4936 -13.9872 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 6
3 2 1 0
4 5 1 6
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
20 9 1 0
9 10 2 0
19 11 1 0
11 14 1 0
13 12 1 0
12 10 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 4 1 0
4 13 1 0
9 17 1 0
17 18 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 2 1 0
2 19 1 0
14 23 1 1
19 24 1 1
8 25 1 1
6 26 1 6
13 27 1 6
26 28 2 0
28 29 1 0
28 30 1 0
20 31 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 388.59Molecular Weight (Monoisotopic): 388.2977AlogP: 5.02#Rotatable Bonds: 2Polar Surface Area: 49.69Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.99CX LogD: 3.99Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.65Np Likeness Score: 3.41
References 1. Liu M, Sun W, Shen L, Hao X, Al Anbari WH, Lin S, Li H, Gao W, Wang J, Hu Z, Zhang Y.. (2019) Bipolaricins A-I, Ophiobolin-Type Tetracyclic Sesterterpenes from a Phytopathogenic Bipolaris sp. Fungus., 82 (10): [PMID:31573805 ] [10.1021/acs.jnatprod.9b00744 ]