3-(benzo[d][1,3]dioxol-5-yl)-2-ethyl-4-oxo-6-propyl-4H-chromen-7-yl propionate

ID: ALA4464551

Cas Number: 159647-56-0

PubChem CID: 984047

Max Phase: Preclinical

Molecular Formula: C24H24O6

Molecular Weight: 408.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCc1cc2c(=O)c(-c3ccc4c(c3)OCO4)c(CC)oc2cc1OC(=O)CC

Standard InChI:  InChI=1S/C24H24O6/c1-4-7-14-10-16-20(12-19(14)30-22(25)6-3)29-17(5-2)23(24(16)26)15-8-9-18-21(11-15)28-13-27-18/h8-12H,4-7,13H2,1-3H3

Standard InChI Key:  QQIKQFQFMCDRLW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    3.4366   -3.6567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4354   -4.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1435   -4.8852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1417   -3.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7288   -3.2483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7286   -2.4311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0208   -2.0226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4362   -2.0223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3131   -2.4314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7274   -4.8843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0200   -4.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3120   -4.8831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8503   -3.6531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8491   -4.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5553   -4.8828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2672   -4.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2684   -3.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5576   -3.2415    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5531   -5.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9771   -3.2482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6838   -3.6585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9738   -4.8863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9700   -5.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6757   -6.1113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6789   -4.4764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3852   -4.8832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3863   -5.7011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1646   -5.9528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6445   -5.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1628   -4.6294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3 14  2  0
 13  4  2  0
  4  1  1  0
  1  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  2 10  1  0
 10 11  1  0
 11 12  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 15 19  2  0
 17 20  1  0
 20 21  1  0
 16 22  1  0
 22 23  2  0
 23 24  1  0
 24 27  2  0
 26 25  2  0
 25 22  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 26  1  0
M  END

Associated Targets(Human)

GABRA1 Tclin GABA-A receptor; alpha-1/beta-2/gamma-2 (1171 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.45Molecular Weight (Monoisotopic): 408.1573AlogP: 5.02#Rotatable Bonds: 6
Polar Surface Area: 74.97Molecular Species: HBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.40CX LogD: 5.40
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.42Np Likeness Score: 0.32

References

1. Solomon VR, Tallapragada VJ, Chebib M, Johnston GAR, Hanrahan JR..  (2019)  GABA allosteric modulators: An overview of recent developments in non-benzodiazepine modulators.,  171  [PMID:30928713] [10.1016/j.ejmech.2019.03.043]

Source