The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2,4-dibromobenzene-1,3,5-triyl)tris(methylene)tricarbamimidothioate trihydrobromide ID: ALA4464895
PubChem CID: 9987588
Max Phase: Preclinical
Molecular Formula: C12H19Br5N6S3
Molecular Weight: 500.31
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Br.Br.Br.N=C(N)SCc1cc(CSC(=N)N)c(Br)c(CSC(=N)N)c1Br
Standard InChI: InChI=1S/C12H16Br2N6S3.3BrH/c13-8-5(2-21-10(15)16)1-6(3-22-11(17)18)9(14)7(8)4-23-12(19)20;;;/h1H,2-4H2,(H3,15,16)(H3,17,18)(H3,19,20);3*1H
Standard InChI Key: AEGKQQATUPWAIE-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 23 0 0 0 0 0 0 0 0999 V2000
13.6983 -14.0738 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
13.6391 -8.6630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6379 -9.4826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3460 -9.8915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0556 -9.4821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0528 -8.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3442 -8.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9299 -9.8906 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
15.7640 -9.8896 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
14.3458 -10.7087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6380 -11.1171 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.9313 -8.2546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2237 -8.6634 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.7590 -8.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4682 -8.6541 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.1744 -8.2428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8836 -8.6487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1713 -7.4256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6378 -11.9343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9300 -12.3427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3454 -12.3431 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5158 -8.2549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8082 -8.6637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5157 -7.4377 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8735 -9.1253 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
19.3237 -9.5587 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
3 8 1 0
5 9 1 0
4 10 1 0
10 11 1 0
2 12 1 0
12 13 1 0
6 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
11 19 1 0
19 20 1 0
19 21 2 0
13 22 1 0
22 23 1 0
22 24 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.31Molecular Weight (Monoisotopic): 497.8965AlogP: 3.59#Rotatable Bonds: 6Polar Surface Area: 149.61Molecular Species: BASEHBA: 6HBD: 6#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 9#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 11.01CX LogP: 3.69CX LogD: -3.33Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.26Np Likeness Score: -0.27
References 1. Peterková L, Kmoníčková E, Ruml T, Rimpelová S.. (2020) Sarco/Endoplasmic Reticulum Calcium ATPase Inhibitors: Beyond Anticancer Perspective., 63 (5): [PMID:32030976 ] [10.1021/acs.jmedchem.9b01509 ]