O-methyl phenylbutazone

ID: ALA4465035

Cas Number: 27258-01-1

PubChem CID: 213909

Max Phase: Preclinical

Molecular Formula: C20H22N2O2

Molecular Weight: 322.41

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCc1c(OC)n(-c2ccccc2)n(-c2ccccc2)c1=O

Standard InChI:  InChI=1S/C20H22N2O2/c1-3-4-15-18-19(23)21(16-11-7-5-8-12-16)22(20(18)24-2)17-13-9-6-10-14-17/h5-14H,3-4,15H2,1-2H3

Standard InChI Key:  HZWCYMHYZRAXMH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   33.0384  -25.2759    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3041  -26.0688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7026  -24.7944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1260  -26.0647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3792  -25.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8475  -26.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2663  -24.9936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7026  -23.9642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.6159  -26.7330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.1762  -25.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2294  -27.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0214  -26.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6354  -25.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1210  -24.1800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7823  -25.5914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5669  -25.3507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1729  -25.9068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5731  -27.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8632  -25.2303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3531  -23.8936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7644  -28.1858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7221  -24.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9467  -28.1484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4185  -23.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  2  1  0
  5  3  2  0
  6  2  1  0
  7  1  1  0
  8  3  1  0
  9  4  2  0
 10  5  1  0
 11  6  1  0
 12  6  2  0
 13  7  1  0
 14  7  2  0
 15 10  1  0
 16 15  1  0
 17 16  1  0
 18 12  1  0
 19 13  2  0
 20 14  1  0
 21 11  2  0
 22 20  2  0
 23 18  2  0
  5  4  1  0
 19 22  1  0
 21 23  1  0
  8 24  1  0
M  END

Alternative Forms

Associated Targets(Human)

ALB Tchem Serum albumin (2651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 322.41Molecular Weight (Monoisotopic): 322.1681AlogP: 3.98#Rotatable Bonds: 6
Polar Surface Area: 36.16Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 5.27CX LogD: 5.27
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.69Np Likeness Score: -0.42

References

1. Dargó G, Bajusz D, Simon K, Müller J, Balogh GT..  (2020)  Human Serum Albumin Binding in a Vial: A Novel UV-pH Titration Method To Assist Drug Design.,  63  (4): [PMID:31995375] [10.1021/acs.jmedchem.0c00046]

Source