((1aR,7aS,10aS,10bS,E)-1a-methyl-8-methylene-9-oxo-1a,2,3,6,7,7a,8,9,10a,10b-decahydrooxireno[2',3':9,10]cyclodeca[1,2-b]furan-5-yl)methyl 2-(3-(2,4-difluorobenzyl)-5-fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetate

ID: ALA4465045

PubChem CID: 155530745

Max Phase: Preclinical

Molecular Formula: C28H27F3N2O7

Molecular Weight: 560.53

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(=O)Cn1cc(F)c(=O)n(Cc3ccc(F)cc3F)c1=O)=C\CC[C@@]1(C)O[C@@H]21

Standard InChI:  InChI=1S/C28H27F3N2O7/c1-15-19-8-5-16(4-3-9-28(2)24(40-28)23(19)39-26(15)36)14-38-22(34)13-32-12-21(31)25(35)33(27(32)37)11-17-6-7-18(29)10-20(17)30/h4,6-7,10,12,19,23-24H,1,3,5,8-9,11,13-14H2,2H3/b16-4+/t19-,23-,24-,28+/m0/s1

Standard InChI Key:  GQHJHWAIPHXCCB-WJWRZYOISA-N

Molfile:  

 
     RDKit          2D

 43 47  0  0  0  0  0  0  0  0999 V2000
   29.7990  -20.2801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2504  -19.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4334  -19.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0587  -21.5967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6865  -21.0690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3630  -21.1626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5606  -20.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3746  -20.3076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5700  -19.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8796  -19.0803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8534  -18.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0573  -18.7248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1909  -17.7604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3928  -17.9726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5778  -17.8759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2675  -18.3142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9919  -17.9360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0267  -17.1196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7544  -20.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1792  -18.7812    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   32.4800  -21.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1851  -20.2381    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   31.1164  -22.4118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8778  -20.7393    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   33.6816  -18.3744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4061  -17.9962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0933  -18.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8154  -18.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8544  -17.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1650  -16.8053    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.4365  -17.1815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7467  -16.7434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5803  -16.8704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5035  -18.5033    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   35.2025  -15.9890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9282  -15.6133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6154  -16.0574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3406  -15.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3786  -14.8652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6855  -14.4245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9630  -14.8020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2733  -14.3637    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.1039  -14.4886    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
  4  5  1  0
  5  8  1  0
  7  6  1  0
  6  4  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  2  7  1  0
 10 11  1  0
  3 12  1  0
 11 13  2  0
 12 14  1  0
 13 14  1  0
 11 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
  3 19  1  1
  2 20  1  1
  5 21  2  0
  8 22  1  6
  4 23  2  0
  7 24  1  1
 17 25  1  0
 25 26  1  0
 26 27  1  0
 26 31  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 29 33  2  0
 28 34  1  0
 30 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 41 42  1  0
 39 43  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4465045

    ---

Associated Targets(Human)

Bel7402/5-FU (373 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Bel-7402 (4577 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 560.53Molecular Weight (Monoisotopic): 560.1770AlogP: 2.77#Rotatable Bonds: 6
Polar Surface Area: 109.13Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 3.73CX LogD: 3.73
Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.23Np Likeness Score: 0.74

References

1. Ding Y, Li S, Ge W, Liu Z, Zhang X, Wang M, Chen T, Chen Y, Zhang Q..  (2019)  Design and synthesis of parthenolide and 5-fluorouracil conjugates as potential anticancer agents against drug resistant hepatocellular carcinoma.,  183  [PMID:31553932] [10.1016/j.ejmech.2019.111706]

Source