3-(2-methyl-1H-imidazol-1-yl)-N-(3-(3-p-tolyl-1H-pyrazol-5-yl)phenyl)-5-(trifluoromethyl)benzamide

ID: ALA4465192

PubChem CID: 155530863

Max Phase: Preclinical

Molecular Formula: C28H22F3N5O

Molecular Weight: 501.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2cc(-c3cccc(NC(=O)c4cc(-n5ccnc5C)cc(C(F)(F)F)c4)c3)[nH]n2)cc1

Standard InChI:  InChI=1S/C28H22F3N5O/c1-17-6-8-19(9-7-17)25-16-26(35-34-25)20-4-3-5-23(13-20)33-27(37)21-12-22(28(29,30)31)15-24(14-21)36-11-10-32-18(36)2/h3-16H,1-2H3,(H,33,37)(H,34,35)

Standard InChI Key:  JWTHYBNVHVSYMC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    3.8740  -20.0129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8729  -20.8324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5809  -21.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2906  -20.8320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2878  -20.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5792  -19.6040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1676  -21.2437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4213  -20.9108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8740  -21.5177    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2821  -22.2257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0815  -22.0564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9990  -21.2394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7060  -20.8297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7047  -20.0125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4111  -21.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4110  -22.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1185  -22.4603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8266  -22.0505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8227  -21.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1146  -20.8254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9529  -22.9691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1389  -23.0528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8060  -23.7982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2860  -24.4606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1027  -24.3728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4319  -23.6271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9541  -25.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1207  -23.2819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1215  -24.0254    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.4593  -23.8221    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.7833  -23.8207    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.5252  -20.8166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2734  -21.1451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8171  -20.5351    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4049  -19.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6065  -20.0035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4474  -21.9436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  7  2  0
  2  7  1  0
  4 12  1  0
 12 13  1  0
 13 14  2  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 10 21  1  0
 24 27  1  0
 28 29  1  0
 28 30  1  0
 28 31  1  0
 17 28  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 32  1  0
 19 32  1  0
 33 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4465192

    ---

Associated Targets(Human)

RAF1 Tclin Serine/threonine-protein kinase RAF (4169 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BRAF Tclin Serine/threonine-protein kinase B-raf (11587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 501.51Molecular Weight (Monoisotopic): 501.1776AlogP: 6.82#Rotatable Bonds: 5
Polar Surface Area: 75.60Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.61CX Basic pKa: 6.64CX LogP: 6.25CX LogD: 6.18
Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.28Np Likeness Score: -2.10

References

1. Jung H, Kim J, Im D, Moon H, Hah JM..  (2019)  Design, synthesis, and in vitro evaluation of N-(3-(3-alkyl-1H-pyrazol-5-yl) phenyl)-aryl amide for selective RAF inhibition.,  29  (4): [PMID:30630714] [10.1016/j.bmcl.2019.01.003]

Source