2-{[6-(4-Bromophenyl)-2-ethylimidazo[2,1-b][1,3,4]thiadiazol-5-ylmethylene]hydrazono}-3-(4-hydroxyphenyl)-4-methyl-2,3-dihydrothiazole-5-carboxylic acid ethyl ester

ID: ALA4465706

PubChem CID: 155531269

Max Phase: Preclinical

Molecular Formula: C26H23BrN6O3S2

Molecular Weight: 611.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1s/c(=N\N=C\c2c(-c3ccc(Br)cc3)nc3sc(CC)nn23)n(-c2ccc(O)cc2)c1C

Standard InChI:  InChI=1S/C26H23BrN6O3S2/c1-4-21-31-33-20(22(29-25(33)37-21)16-6-8-17(27)9-7-16)14-28-30-26-32(18-10-12-19(34)13-11-18)15(3)23(38-26)24(35)36-5-2/h6-14,34H,4-5H2,1-3H3/b28-14+,30-26-

Standard InChI Key:  ZYVWDHJMGXJIIE-QIZPUFOESA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   41.9925  -25.9615    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.9740  -24.6186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5016  -25.2969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7677  -24.8638    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.7768  -25.6921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5677  -25.9423    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   44.0489  -25.2659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5528  -24.6005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.6781  -25.3094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2525  -24.5957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4252  -24.6069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0224  -25.3310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4487  -26.0453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2747  -26.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7077  -23.8347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8949  -23.6754    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.6286  -22.8914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.8202  -22.7308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4740  -21.9857    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.6557  -22.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4951  -22.8912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2143  -23.2936    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   39.8732  -21.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6983  -21.2558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0997  -20.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6771  -19.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8489  -19.8434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4512  -20.5627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0776  -19.1157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.0961  -21.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7469  -23.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0737  -22.7611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.6718  -24.0571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.3254  -23.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6523  -22.6310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1984  -25.3435    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   44.8730  -25.2568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2929  -25.9658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  5  2  0
  4  2  1  0
  2  3  2  0
  3  1  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  3  9  1  0
  2 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 18  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 19 23  1  0
 26 29  1  0
 20 30  1  0
 21 31  1  0
 31 32  1  0
 31 33  2  0
 32 34  1  0
 34 35  1  0
 12 36  1  0
  7 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4465706

    ---

Associated Targets(non-human)

Trypanosoma brucei gambiense (523 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 611.55Molecular Weight (Monoisotopic): 610.0456AlogP: 5.76#Rotatable Bonds: 7
Polar Surface Area: 106.37Molecular Species: NEUTRALHBA: 11HBD: 1
#RO5 Violations: 3HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.88CX Basic pKa: 1.96CX LogP: 6.85CX LogD: 6.84
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.14Np Likeness Score: -1.53

References

1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R..  (2019)  Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents.,  174  [PMID:31051403] [10.1016/j.ejmech.2019.04.052]

Source