The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[(2-Allylsulfanyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-ylmethylene)hydrazono]-4-methyl-2,3-dihydrothiazole-5-carboxylic acid ethyl ester ID: ALA4465788
PubChem CID: 155531342
Max Phase: Preclinical
Molecular Formula: C21H20N6O2S3
Molecular Weight: 484.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CCSc1nn2c(/C=N/N=c3/[nH]c(C)c(C(=O)OCC)s3)c(-c3ccccc3)nc2s1
Standard InChI: InChI=1S/C21H20N6O2S3/c1-4-11-30-21-26-27-15(16(24-20(27)32-21)14-9-7-6-8-10-14)12-22-25-19-23-13(3)17(31-19)18(28)29-5-2/h4,6-10,12H,1,5,11H2,2-3H3,(H,23,25)/b22-12+
Standard InChI Key: GSCGWWWUALYTHP-WSDLNYQXSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
9.2121 -14.7578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1938 -13.4169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7219 -14.0941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9863 -13.6617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9954 -14.4889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7853 -14.7386 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.2657 -14.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7703 -13.3986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8996 -14.1067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4747 -13.3940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6484 -13.4051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2461 -14.1281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6719 -14.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4967 -14.8269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9278 -12.6339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1162 -12.4749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8501 -11.6920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0430 -11.5317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6972 -10.7876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8799 -10.8845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7196 -11.6918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4378 -12.0935 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.0887 -14.0540 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.5080 -14.7621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3310 -14.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7503 -15.4611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3211 -10.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9724 -12.0366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3002 -11.5619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8974 -12.8561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5530 -11.9067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8808 -11.4320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 5 2 0
4 2 1 0
2 3 2 0
3 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
3 9 1 0
2 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 18 1 0
7 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
20 27 1 0
21 28 1 0
28 29 1 0
28 30 2 0
29 31 1 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.63Molecular Weight (Monoisotopic): 484.0810AlogP: 4.55#Rotatable Bonds: 8Polar Surface Area: 97.00Molecular Species: ACIDHBA: 10HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.46CX Basic pKa: 2.23CX LogP: 5.58CX LogD: 4.83Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.13Np Likeness Score: -1.80
References 1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R.. (2019) Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents., 174 [PMID:31051403 ] [10.1016/j.ejmech.2019.04.052 ]