The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(1-(Benzylamino)-3,3-dimethyl-1-oxobutan-2-yl)-N-butyl-4-(4-fluorophenyl)-4-oxobut-2-enamide ID: ALA4465914
PubChem CID: 155531650
Max Phase: Preclinical
Molecular Formula: C27H33FN2O3
Molecular Weight: 452.57
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCN(C(=O)/C=C/C(=O)c1ccc(F)cc1)C(C(=O)NCc1ccccc1)C(C)(C)C
Standard InChI: InChI=1S/C27H33FN2O3/c1-5-6-18-30(24(32)17-16-23(31)21-12-14-22(28)15-13-21)25(27(2,3)4)26(33)29-19-20-10-8-7-9-11-20/h7-17,25H,5-6,18-19H2,1-4H3,(H,29,33)/b17-16+
Standard InChI Key: LFEPGAUCNKSLRH-WUKNDPDISA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
16.5569 -5.2124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5557 -6.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2705 -6.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9870 -6.0394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9841 -5.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2687 -4.7997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8409 -6.4518 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.6970 -4.7937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4130 -5.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1260 -4.7882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8419 -5.1981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6939 -3.9687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8451 -6.0230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5549 -4.7829 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2709 -5.1926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9838 -4.7775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6998 -5.1873 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9807 -3.9525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2747 -6.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5512 -3.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4127 -4.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8350 -3.5505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8312 -2.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5621 -6.4325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9910 -6.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2666 -6.8416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1288 -5.1819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1294 -6.0052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8446 -6.4150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5585 -5.9997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5528 -5.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8370 -4.7645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1150 -2.3162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
5 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
8 12 2 0
11 13 2 0
11 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
15 19 1 0
14 20 1 0
17 21 1 0
20 22 1 0
22 23 1 0
19 24 1 0
19 25 1 0
19 26 1 0
21 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
23 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.57Molecular Weight (Monoisotopic): 452.2475AlogP: 4.92#Rotatable Bonds: 10Polar Surface Area: 66.48Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.27CX LogD: 5.27Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -0.92
References 1. Jovanović M, Zhukovsky D, Podolski-Renić A, Domračeva I, Žalubovskis R, Senćanski M, Glišić S, Sharoyko V, Tennikova T, Dar'in D, Pešić M, Krasavin M.. (2019) Novel electrophilic amides amenable by the Ugi reaction perturb thioredoxin system via thioredoxin reductase 1 (TrxR1) inhibition: Identification of DVD-445 as a new lead compound for anticancer therapy., 181 [PMID:31400708 ] [10.1016/j.ejmech.2019.111580 ]