The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(4-((2,3-dioxoindolin-1-yl)methyl)-3-methylpiperazin-1-yl)-1-ethyl-6,8-difluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid ID: ALA4465936
PubChem CID: 15411204
Max Phase: Preclinical
Molecular Formula: C26H24F2N4O5
Molecular Weight: 510.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(CN4C(=O)C(=O)c5ccccc54)C(C)C3)c(F)c21
Standard InChI: InChI=1S/C26H24F2N4O5/c1-3-29-12-17(26(36)37)23(33)16-10-18(27)22(20(28)21(16)29)30-8-9-31(14(2)11-30)13-32-19-7-5-4-6-15(19)24(34)25(32)35/h4-7,10,12,14H,3,8-9,11,13H2,1-2H3,(H,36,37)
Standard InChI Key: RCJZCPUZIBYHQA-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
31.7962 -18.3373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5019 -17.0991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0904 -17.9287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0822 -17.1115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5061 -17.9246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7879 -16.6905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3764 -18.3373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6706 -17.9287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9608 -18.3373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.6706 -17.1115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8003 -19.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3764 -16.7029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2077 -16.6905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2550 -17.9287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7838 -15.8733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5410 -19.1545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.2077 -15.8733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9649 -16.7029 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.9649 -19.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5493 -18.3373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9176 -17.0991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.2468 -19.5631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8310 -19.5591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1256 -19.1465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0441 -18.3291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2457 -18.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3765 -19.4704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8350 -18.8591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0369 -19.0230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7792 -19.7977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3257 -20.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1218 -20.2416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9170 -17.4065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6544 -17.7856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.5101 -19.5595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3743 -19.1545 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.2437 -20.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 5 2 0
3 1 1 0
4 3 1 0
5 1 1 0
6 2 1 0
7 3 2 0
8 7 1 0
9 8 1 0
10 8 2 0
11 1 1 0
12 4 2 0
13 2 1 0
14 9 1 0
15 6 2 0
16 22 1 0
17 13 2 0
18 10 1 0
19 9 1 0
20 14 1 0
21 13 1 0
22 19 1 0
4 6 1 0
12 10 1 0
20 16 1 0
16 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 28 1 0
27 24 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
26 33 2 0
25 34 2 0
11 35 1 0
7 36 1 0
22 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.50Molecular Weight (Monoisotopic): 510.1715AlogP: 2.70#Rotatable Bonds: 5Polar Surface Area: 103.16Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.46CX Basic pKa: 3.07CX LogP: 3.14CX LogD: 1.20Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.53Np Likeness Score: -0.86
References 1. Xu Z, Zhao SJ, Lv ZS, Gao F, Wang Y, Zhang F, Bai L, Deng JL.. (2019) Fluoroquinolone-isatin hybrids and their biological activities., 162 [PMID:30453247 ] [10.1016/j.ejmech.2018.11.032 ]