The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-hydroxy-N-(2-(4-(3-(hydroxyamino)-3-oxoprop-1-enyl)-2-methoxyphenoxy)ethyl)-N-methylbenzamide ID: ALA4465947
PubChem CID: 155531688
Max Phase: Preclinical
Molecular Formula: C20H22N2O6
Molecular Weight: 386.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C(=O)NO)ccc1OCCN(C)C(=O)c1ccccc1O
Standard InChI: InChI=1S/C20H22N2O6/c1-22(20(25)15-5-3-4-6-16(15)23)11-12-28-17-9-7-14(13-18(17)27-2)8-10-19(24)21-26/h3-10,13,23,26H,11-12H2,1-2H3,(H,21,24)/b10-8+
Standard InChI Key: SJRQWJPPQGTGSY-CSKARUKUSA-N
Molfile:
RDKit 2D
28 29 0 0 0 0 0 0 0 0999 V2000
34.5682 -8.2627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5671 -9.0822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2751 -9.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9848 -9.0817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9820 -8.2591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2734 -7.8538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8591 -9.4902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8604 -7.8542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8602 -7.0371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6881 -7.8478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3974 -8.2537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1036 -7.8425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8128 -8.2484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.1005 -7.0253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.5190 -7.8371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.1517 -9.0811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4437 -9.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7363 -9.0800 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0282 -9.4880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3209 -9.0788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0276 -10.3052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3265 -8.2637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6199 -7.8546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9109 -8.2627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9129 -9.0841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6200 -9.4895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6239 -10.3067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7369 -8.2628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
1 8 1 0
8 9 1 0
5 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
7 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 20 1 0
26 27 1 0
18 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 386.40Molecular Weight (Monoisotopic): 386.1478AlogP: 2.07#Rotatable Bonds: 8Polar Surface Area: 108.33Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.16CX Basic pKa: ┄CX LogP: 2.46CX LogD: 2.39Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.36Np Likeness Score: -0.58
References 1. Sangwan R, Rajan R, Mandal PK.. (2018) HDAC as onco target: Reviewing the synthetic approaches with SAR study of their inhibitors., 158 [PMID:30245394 ] [10.1016/j.ejmech.2018.08.073 ]