3',5-Dimethyl-N-(4-oxo-2-phenyl-4H-chromen-6-yl)-[3,5'-biisoxazole]-4'-carboxamide

ID: ALA4466005

PubChem CID: 155531787

Max Phase: Preclinical

Molecular Formula: C24H17N3O5

Molecular Weight: 427.42

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2onc(C)c2C(=O)Nc2ccc3oc(-c4ccccc4)cc(=O)c3c2)no1

Standard InChI:  InChI=1S/C24H17N3O5/c1-13-10-18(27-31-13)23-22(14(2)26-32-23)24(29)25-16-8-9-20-17(11-16)19(28)12-21(30-20)15-6-4-3-5-7-15/h3-12H,1-2H3,(H,25,29)

Standard InChI Key:  PIWQUIOZQYWJQX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   28.2285  -27.8282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2223  -28.6495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0012  -28.9097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4924  -28.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0112  -27.5839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3096  -28.2564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7235  -27.5518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.7129  -28.9672    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5301  -28.9732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9315  -29.6860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7549  -28.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9398  -28.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2459  -29.6894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2653  -26.8073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0443  -26.5604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0502  -25.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2748  -25.4851    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7898  -26.1427    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.7148  -25.2677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1626  -28.9873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7462  -29.6900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1444  -30.3980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9605  -30.4094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3769  -29.7067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9771  -28.9926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.7269  -31.1004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.1914  -29.7173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5906  -30.4316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4070  -30.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8251  -29.7389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4209  -29.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6058  -29.0169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  4  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 21  1  0
 20 11  1  0
 11 12  2  0
 12  9  1  0
  3 13  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 14  2  0
  5 14  1  0
 16 19  1  0
 20 21  2  0
 20 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 22 26  2  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 24 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4466005

    ---

Associated Targets(non-human)

Nkx2-5 Homeobox protein Nkx-2.5 (120 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Gata4 Transcription factor GATA-4 (136 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.42Molecular Weight (Monoisotopic): 427.1168AlogP: 4.97#Rotatable Bonds: 4
Polar Surface Area: 111.37Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.81CX Basic pKa: CX LogP: 3.07CX LogD: 3.07
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -1.08

References

1. Jumppanen M, Kinnunen SM, Välimäki MJ, Talman V, Auno S, Bruun T, Boije Af Gennäs G, Xhaard H, Aumüller IB, Ruskoaho H, Yli-Kauhaluoma J..  (2019)  Synthesis, Identification, and Structure-Activity Relationship Analysis of GATA4 and NKX2-5 Protein-Protein Interaction Modulators.,  62  (17): [PMID:31431011] [10.1021/acs.jmedchem.9b01086]

Source