The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Isopropyl ((((1R,3S,5S)-1-(4-amino-2-oxopyrimidin-1(2H)-yl)-2-oxabicyclo[3.1.0]hexan-3 yl)methoxy)(phenoxy)phosphoryl)-L-alaninate ID: ALA4466009
PubChem CID: 155531856
Max Phase: Preclinical
Molecular Formula: C17H27N4O7P
Molecular Weight: 430.40
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COP(=O)(N[C@@H](C)C(=O)OC(C)C)OC[C@@H]1C[C@H]2C[C@@]2(n2ccc(N)nc2=O)O1
Standard InChI: InChI=1S/C17H27N4O7P/c1-10(2)27-15(22)11(3)20-29(24,25-4)26-9-13-7-12-8-17(12,28-13)21-6-5-14(18)19-16(21)23/h5-6,10-13H,7-9H2,1-4H3,(H,20,24)(H2,18,19,23)/t11-,12-,13-,17+,29?/m0/s1
Standard InChI Key: GMTMECRWKCZUTK-VOCIQWDOSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
16.9026 -3.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9163 -3.8479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6325 -4.2424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3351 -3.8241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3215 -3.0071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6051 -2.6041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6463 -5.0636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0254 -2.5856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4612 -3.7388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8396 -4.2742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1541 -5.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0431 -4.0825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8077 -3.2945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1636 -4.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9775 -4.9628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7586 -4.7243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4756 -5.6115 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.0126 -3.1056 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
12.7787 -2.3226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4515 -3.6997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6564 -3.5108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2195 -3.8920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8068 -4.5977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9896 -4.5932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2114 -5.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7989 -6.0131 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0286 -5.3123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4333 -6.0222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2504 -6.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0207 -6.7276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 2 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
3 7 2 0
5 8 1 0
14 9 1 0
9 10 1 0
10 11 1 0
11 15 1 0
14 2 1 1
10 12 1 1
12 13 1 0
15 14 1 0
16 15 1 0
14 16 1 0
15 17 1 1
13 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
18 22 1 0
22 23 1 0
23 24 1 6
23 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.40Molecular Weight (Monoisotopic): 430.1617AlogP: 0.99#Rotatable Bonds: 9Polar Surface Area: 144.00Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.46CX Basic pKa: ┄CX LogP: -0.31CX LogD: -0.31Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.43Np Likeness Score: 0.28