The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3-(2-(1H-indol-3-yl)vinyl)-5-bromobenzofuran-2-yl)(4-bromophenyl)methanone ID: ALA4466572
PubChem CID: 155532013
Max Phase: Preclinical
Molecular Formula: C25H15Br2NO2
Molecular Weight: 521.21
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccc(Br)cc1)c1oc2ccc(Br)cc2c1/C=C/c1c[nH]c2ccccc12
Standard InChI: InChI=1S/C25H15Br2NO2/c26-17-8-5-15(6-9-17)24(29)25-20(21-13-18(27)10-12-23(21)30-25)11-7-16-14-28-22-4-2-1-3-19(16)22/h1-14,28H/b11-7+
Standard InChI Key: NWRWQIOAVQJBHE-YRNVUSSQSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
31.2912 -11.3168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2901 -12.1405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0023 -12.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0005 -10.9038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7132 -11.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7180 -12.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5022 -12.3844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9795 -11.7152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4944 -11.0516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.8008 -11.7103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7592 -13.1643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5636 -13.3295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8207 -14.1094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3486 -14.7759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8328 -15.4384 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.6078 -14.3559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6113 -15.1740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3210 -15.5804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0277 -15.1656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0202 -14.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3100 -13.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2177 -12.4198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2094 -10.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0306 -10.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4349 -10.2806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0221 -9.5744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1966 -9.5818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7918 -10.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5779 -12.5485 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
36.4256 -8.8596 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
8 10 1 0
7 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 17 1 0
16 13 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
10 22 2 0
10 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
2 29 1 0
26 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.21Molecular Weight (Monoisotopic): 518.9470AlogP: 7.84#Rotatable Bonds: 4Polar Surface Area: 46.00Molecular Species: NEUTRALHBA: 2HBD: 1#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.49CX LogD: 7.49Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.25Np Likeness Score: -0.20
References 1. Xu Z, Zhao S, Lv Z, Feng L, Wang Y, Zhang F, Bai L, Deng J.. (2019) Benzofuran derivatives and their anti-tubercular, anti-bacterial activities., 162 [PMID:30448416 ] [10.1016/j.ejmech.2018.11.025 ]