2-(3-fluoro-4-(7-(2-(pyridin-2-ylmethoxy)phenyl)thieno[2,3-d]pyridazin-4-ylamino)phenyl)acetamide

ID: ALA4466592

PubChem CID: 155532109

Max Phase: Preclinical

Molecular Formula: C26H20FN5O2S

Molecular Weight: 485.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=O)Cc1ccc(Nc2nnc(-c3ccccc3OCc3ccccn3)c3sccc23)c(F)c1

Standard InChI:  InChI=1S/C26H20FN5O2S/c27-20-13-16(14-23(28)33)8-9-21(20)30-26-19-10-12-35-25(19)24(31-32-26)18-6-1-2-7-22(18)34-15-17-5-3-4-11-29-17/h1-13H,14-15H2,(H2,28,33)(H,30,32)

Standard InChI Key:  HUMVRKWQRNLBMF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   19.1256   -8.6383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3023   -6.1894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0119   -5.7800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0091   -4.9573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3005   -4.5520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5942   -5.7804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5955   -4.9639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8193   -4.7104    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.3383   -5.3703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8173   -6.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2953   -3.7401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0028   -3.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9994   -2.5124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2892   -2.1063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5811   -2.5225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5880   -3.3376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3021   -7.0066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0097   -7.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0054   -8.2308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7121   -8.6395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4209   -8.2310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4185   -7.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7111   -7.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8363   -8.2294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5445   -8.6373    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8354   -7.4123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2964   -8.6372    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.7119   -3.7349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4182   -3.3238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1273   -3.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1257   -4.5452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8341   -4.9511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5413   -4.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5357   -3.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8268   -3.3163    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  6  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  7  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10  6  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  5 11  1  0
  2 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21  1  1  0
  1 24  1  0
 24 25  1  0
 24 26  2  0
 19 27  1  0
 12 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4466592

    ---

Associated Targets(non-human)

Slc2a4 Solute carrier family 2, facilitated glucose transporter member 4 (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 485.54Molecular Weight (Monoisotopic): 485.1322AlogP: 5.24#Rotatable Bonds: 8
Polar Surface Area: 103.02Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.93CX Basic pKa: 3.78CX LogP: 4.12CX LogD: 4.12
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.31Np Likeness Score: -1.87

References

1. Tsuji T, Yamaguchi M, Kuroyanagi J, Furuzono S, Konishi M, Terayama K, Tanaka J, Saito M, Kobayashi Y..  (2019)  Discovery of novel pyridazine derivatives as glucose transporter type 4 (GLUT4) translocation activators.,  29  (14): [PMID:31101471] [10.1016/j.bmcl.2019.05.013]

Source