The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-fluoro-4-(7-(2-(pyridin-2-ylmethoxy)phenyl)thieno[2,3-d]pyridazin-4-ylamino)phenyl)acetamide ID: ALA4466592
PubChem CID: 155532109
Max Phase: Preclinical
Molecular Formula: C26H20FN5O2S
Molecular Weight: 485.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)Cc1ccc(Nc2nnc(-c3ccccc3OCc3ccccn3)c3sccc23)c(F)c1
Standard InChI: InChI=1S/C26H20FN5O2S/c27-20-13-16(14-23(28)33)8-9-21(20)30-26-19-10-12-35-25(19)24(31-32-26)18-6-1-2-7-22(18)34-15-17-5-3-4-11-29-17/h1-13H,14-15H2,(H2,28,33)(H,30,32)
Standard InChI Key: HUMVRKWQRNLBMF-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
19.1256 -8.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3023 -6.1894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0119 -5.7800 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0091 -4.9573 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3005 -4.5520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5942 -5.7804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5955 -4.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8193 -4.7104 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.3383 -5.3703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8173 -6.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2953 -3.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0028 -3.3289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9994 -2.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2892 -2.1063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5811 -2.5225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5880 -3.3376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3021 -7.0066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0097 -7.4154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0054 -8.2308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7121 -8.6395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4209 -8.2310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4185 -7.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7111 -7.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8363 -8.2294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5445 -8.6373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8354 -7.4123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2964 -8.6372 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.7119 -3.7349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4182 -3.3238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1273 -3.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1257 -4.5452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8341 -4.9511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5413 -4.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5357 -3.7186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8268 -3.3163 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 7 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 2 0
10 6 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
5 11 1 0
2 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 1 1 0
1 24 1 0
24 25 1 0
24 26 2 0
19 27 1 0
12 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.54Molecular Weight (Monoisotopic): 485.1322AlogP: 5.24#Rotatable Bonds: 8Polar Surface Area: 103.02Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.93CX Basic pKa: 3.78CX LogP: 4.12CX LogD: 4.12Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.31Np Likeness Score: -1.87
References 1. Tsuji T, Yamaguchi M, Kuroyanagi J, Furuzono S, Konishi M, Terayama K, Tanaka J, Saito M, Kobayashi Y.. (2019) Discovery of novel pyridazine derivatives as glucose transporter type 4 (GLUT4) translocation activators., 29 (14): [PMID:31101471 ] [10.1016/j.bmcl.2019.05.013 ]