2-(3-fluorobenzyloxy)-N-(pyridin-3-yl)benzamide

ID: ALA4466639

PubChem CID: 118911652

Max Phase: Preclinical

Molecular Formula: C19H15FN2O2

Molecular Weight: 322.34

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1cccnc1)c1ccccc1OCc1cccc(F)c1

Standard InChI:  InChI=1S/C19H15FN2O2/c20-15-6-3-5-14(11-15)13-24-18-9-2-1-8-17(18)19(23)22-16-7-4-10-21-12-16/h1-12H,13H2,(H,22,23)

Standard InChI Key:  ANAFAHZDDIMSJV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    8.5791  -18.5601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5779  -19.3796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2860  -19.7886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9957  -19.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9928  -18.5565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2842  -18.1512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6990  -18.1453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4082  -18.5512    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6959  -17.3281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1144  -18.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7040  -19.7867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7053  -20.6038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4136  -21.0113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4103  -21.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1178  -22.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8259  -21.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8220  -21.0021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1139  -20.5984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1187  -23.0505    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.8221  -18.5492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5277  -18.1387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5251  -17.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8109  -16.9149    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1081  -17.3278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
  4 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 15 19  1  0
 10 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 10  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4466639

    ---

Associated Targets(Human)

SGMS2 Tchem Phosphatidylcholine:ceramide cholinephosphotransferase 2 (194 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 322.34Molecular Weight (Monoisotopic): 322.1118AlogP: 4.05#Rotatable Bonds: 5
Polar Surface Area: 51.22Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.37CX LogP: 3.56CX LogD: 3.56
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.77Np Likeness Score: -1.96

References

1. Li Y, Huang T, Lou B, Ye D, Qi X, Li X, Hu S, Ding T, Chen Y, Cao Y, Mo M, Dong J, Wei M, Chu Y, Li H, Jiang XC, Cheng N, Zhou L..  (2019)  Discovery, synthesis and anti-atherosclerotic activities of a novel selective sphingomyelin synthase 2 inhibitor.,  163  [PMID:30580239] [10.1016/j.ejmech.2018.12.028]

Source