The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 2,6-dimethyl-4-(3-nitrophenyl)-5-((((R)-1-(4-(trifluoromethyl)phenethyl)pyrrolidin-3-yl)methyl)carbamoyl)-1,4-dihydropyridine-3-carboxylate ID: ALA4466934
PubChem CID: 155532044
Max Phase: Preclinical
Molecular Formula: C30H33F3N4O5
Molecular Weight: 586.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1=C(C)NC(C)=C(C(=O)NC[C@H]2CCN(CCc3ccc(C(F)(F)F)cc3)C2)C1c1cccc([N+](=O)[O-])c1
Standard InChI: InChI=1S/C30H33F3N4O5/c1-18-25(27(26(19(2)35-18)29(39)42-3)22-5-4-6-24(15-22)37(40)41)28(38)34-16-21-12-14-36(17-21)13-11-20-7-9-23(10-8-20)30(31,32)33/h4-10,15,21,27,35H,11-14,16-17H2,1-3H3,(H,34,38)/t21-,27?/m1/s1
Standard InChI Key: FGDIIHAQOMAUNJ-XJQHNOHDSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
33.9067 -19.1667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.7040 -18.9874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7817 -18.1738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0292 -17.8489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4922 -18.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4852 -17.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1971 -18.1591 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.9005 -17.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6124 -18.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8921 -16.9261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.6168 -18.9613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3279 -19.3624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.0323 -18.9465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0211 -18.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3095 -17.7277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2976 -16.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0008 -16.4930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9891 -15.6767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2749 -15.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5710 -15.7012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5862 -16.5161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6932 -15.2576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6816 -14.4404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.4067 -15.6560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.9122 -19.3753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7447 -19.3468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7231 -17.7067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4364 -18.1055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.1384 -17.6871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7117 -16.8896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5821 -19.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7704 -20.0106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4458 -20.7605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6332 -20.8521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3086 -21.6012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7960 -22.2582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6117 -22.1612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9325 -21.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4724 -23.0086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6608 -23.1036 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.9605 -23.6641 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.0594 -23.7151 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
3 6 1 6
6 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 9 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
15 16 1 0
22 23 2 0
22 24 1 0
18 22 1 0
11 25 1 0
13 26 1 0
14 27 1 0
27 28 1 0
28 29 1 0
27 30 2 0
1 31 1 0
31 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
36 39 1 0
39 40 1 0
39 41 1 0
39 42 1 0
M CHG 2 22 1 24 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.61Molecular Weight (Monoisotopic): 586.2403AlogP: 4.70#Rotatable Bonds: 9Polar Surface Area: 113.81Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.21CX LogP: 3.83CX LogD: 2.02Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.25Np Likeness Score: -1.31
References 1. Son WS, Jeong KS, Lim SM, Pae AN.. (2019) Structural hybridization of pyrrolidine-based T-type calcium channel inhibitors and exploration of their analgesic effects in a neuropathic pain model., 29 (10): [PMID:30928197 ] [10.1016/j.bmcl.2019.03.026 ]