The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Apicidin ID: ALA4467135
PubChem CID: 155531877
Max Phase: Preclinical
Molecular Formula: C35H50N4O6
Molecular Weight: 622.81
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)CCCCC[C@@H]1NC(=O)[C@H]2CCCCN2C(=O)[C@H]([C@@H](C)CC)NC(=O)[C@H](Cc2cc3ccccc3n2OC)CC1=O
Standard InChI: InChI=1S/C35H50N4O6/c1-5-23(3)32-35(44)38-19-13-12-18-30(38)34(43)36-28(16-9-7-8-15-27(40)6-2)31(41)22-25(33(42)37-32)21-26-20-24-14-10-11-17-29(24)39(26)45-4/h10-11,14,17,20,23,25,28,30,32H,5-9,12-13,15-16,18-19,21-22H2,1-4H3,(H,36,43)(H,37,42)/t23-,25+,28-,30+,32-/m0/s1
Standard InChI Key: XJEGEVAGSHPOIG-VCELXGRSSA-N
Molfile:
RDKit 2D
47 50 0 0 0 0 0 0 0 0999 V2000
21.2955 -20.2589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0374 -19.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4317 -21.7171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9408 -21.2252 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6945 -20.2597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2830 -19.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6999 -21.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1073 -19.6329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4406 -21.0766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6184 -20.2743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9559 -18.8811 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7406 -22.4821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0862 -21.5881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4590 -18.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2807 -18.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6588 -19.7394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0580 -19.0914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7771 -18.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7977 -17.8746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3512 -18.6662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7712 -22.2580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8125 -19.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7095 -18.1178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5131 -18.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5756 -19.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3110 -19.4772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9887 -19.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9199 -18.1925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1800 -17.8460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3949 -17.3585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8953 -16.7052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6089 -21.7124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1055 -21.0632 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2966 -21.1744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9857 -21.9337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4891 -22.5829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3076 -22.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5180 -22.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1894 -22.1321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9362 -22.4815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6117 -22.0103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3544 -22.3556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0299 -21.8844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4257 -23.1763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7726 -22.2297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0217 -22.4256 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
22.8330 -19.7033 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 5 1 0
1 33 1 0
4 3 1 0
32 3 1 0
5 6 1 0
4 7 1 0
6 8 1 0
7 9 1 0
8 10 1 0
9 10 1 0
6 11 2 0
3 12 2 0
9 13 2 0
8 14 1 6
14 15 1 0
1 16 2 0
2 17 1 0
17 18 1 0
18 19 1 0
17 20 1 1
7 21 1 6
15 22 2 0
22 25 1 0
24 23 1 0
23 15 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
23 30 1 0
30 31 1 0
32 33 1 0
32 37 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
21 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
42 44 2 0
43 45 1 0
32 46 1 6
2 47 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 622.81Molecular Weight (Monoisotopic): 622.3730AlogP: 4.16#Rotatable Bonds: 12Polar Surface Area: 126.81Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.30CX Basic pKa: ┄CX LogP: 4.29CX LogD: 4.29Aromatic Rings: 2Heavy Atoms: 45QED Weighted: 0.34Np Likeness Score: 0.99
References 1. Sangwan R, Rajan R, Mandal PK.. (2018) HDAC as onco target: Reviewing the synthetic approaches with SAR study of their inhibitors., 158 [PMID:30245394 ] [10.1016/j.ejmech.2018.08.073 ]