3-(1-(2-methylquinolin-4-yl)vinyl)-9H-carbazole

ID: ALA4467169

PubChem CID: 155532077

Max Phase: Preclinical

Molecular Formula: C24H18N2

Molecular Weight: 334.42

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(c1ccc2[nH]c3ccccc3c2c1)c1cc(C)nc2ccccc12

Standard InChI:  InChI=1S/C24H18N2/c1-15-13-20(18-7-3-5-9-22(18)25-15)16(2)17-11-12-24-21(14-17)19-8-4-6-10-23(19)26-24/h3-14,26H,2H2,1H3

Standard InChI Key:  DDVGTZNMIQMXDU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 30  0  0  0  0  0  0  0  0999 V2000
    4.5958  -27.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3064  -27.5617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5982  -26.3297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3025  -28.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0123  -28.7987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0157  -27.1556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7261  -27.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7273  -28.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5098  -28.6363    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5078  -27.3086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9874  -27.9739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8020  -27.8884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1381  -27.1382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6493  -26.4727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8364  -26.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8830  -27.5571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4567  -28.3728    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1723  -28.7874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8820  -28.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4596  -27.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1710  -27.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1736  -26.3294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4655  -25.9158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7533  -26.3291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7542  -27.1447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1728  -29.6087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  2  4  2  0
  4  5  1  0
  5  8  2  0
  7  6  2  0
  6  2  1  0
  7  8  1  0
  8  9  1  0
  9 11  1  0
 10  7  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 16 21  2  0
 20 17  2  0
 17 18  1  0
 18 19  2  0
 19 16  1  0
  1 16  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 18 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4467169

    ---

Associated Targets(Human)

CYP3A4 Tclin Cytochrome P450 (380 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 334.42Molecular Weight (Monoisotopic): 334.1470AlogP: 6.24#Rotatable Bonds: 2
Polar Surface Area: 28.68Molecular Species: NEUTRALHBA: 1HBD: 1
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.20CX LogP: 5.55CX LogD: 5.55
Aromatic Rings: 5Heavy Atoms: 26QED Weighted: 0.41Np Likeness Score: -0.31

References

1. Naret T, Khelifi I, Provot O, Bignon J, Levaique H, Dubois J, Souce M, Kasselouri A, Deroussent A, Paci A, Varela PF, Gigant B, Alami M, Hamze A..  (2019)  1,1-Diheterocyclic Ethylenes Derived from Quinaldine and Carbazole as New Tubulin-Polymerization Inhibitors: Synthesis, Metabolism, and Biological Evaluation.,  62  (4): [PMID:30525602] [10.1021/acs.jmedchem.8b01386]

Source