2-hydroxy-N-(3-(4-(3-(hydroxyamino)-3-oxoprop-1-enyl)-2-methoxyphenoxy)propyl)-N-methylbenzamide

ID: ALA4467212

PubChem CID: 155532194

Max Phase: Preclinical

Molecular Formula: C21H24N2O6

Molecular Weight: 400.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(/C=C/C(=O)NO)ccc1OCCCN(C)C(=O)c1ccccc1O

Standard InChI:  InChI=1S/C21H24N2O6/c1-23(21(26)16-6-3-4-7-17(16)24)12-5-13-29-18-10-8-15(14-19(18)28-2)9-11-20(25)22-27/h3-4,6-11,14,24,27H,5,12-13H2,1-2H3,(H,22,25)/b11-9+

Standard InChI Key:  VGWBHKMGVLPTSK-PKNBQFBNSA-N

Molfile:  

 
     RDKit          2D

 29 30  0  0  0  0  0  0  0  0999 V2000
   34.9397  -14.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9386  -15.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6466  -15.4633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3563  -15.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3534  -14.2312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6448  -13.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2305  -15.4623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.2319  -13.8263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.2317  -13.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0596  -13.8199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7688  -14.2258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4750  -13.8146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1842  -14.2205    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.4719  -12.9974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.8904  -13.8092    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.5231  -15.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8151  -15.4612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1077  -15.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3997  -15.4601    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.6923  -15.0509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3990  -16.2773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6930  -14.2338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9843  -15.4590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2795  -15.0482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5720  -15.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5709  -16.2736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2832  -16.6826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9879  -16.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2817  -14.2310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  1  8  1  0
  8  9  1  0
  5 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
  7 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  1  0
 20 22  2  0
 20 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 24 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4467212

    ---

Associated Targets(Human)

HDAC1 Tclin Histone deacetylase (HDAC1 and HDAC2) (618 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HDAC3 Tclin Histone deacetylase 3 (3654 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HDAC6 Tclin Histone deacetylase 6 (20808 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 400.43Molecular Weight (Monoisotopic): 400.1634AlogP: 2.46#Rotatable Bonds: 9
Polar Surface Area: 108.33Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.16CX Basic pKa: CX LogP: 2.52CX LogD: 2.45
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.26Np Likeness Score: -0.51

References

1. Sangwan R, Rajan R, Mandal PK..  (2018)  HDAC as onco target: Reviewing the synthetic approaches with SAR study of their inhibitors.,  158  [PMID:30245394] [10.1016/j.ejmech.2018.08.073]

Source