The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(4-amino-7-isopropylpyrrolo[1,2-f][1,2,4]triazine-5-carbonyl)phenyl)-3-(4-(benzyloxy)phenyl)urea ID: ALA4467309
PubChem CID: 16739855
Max Phase: Preclinical
Molecular Formula: C30H28N6O3
Molecular Weight: 520.59
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1cc(C(=O)c2cccc(NC(=O)Nc3ccc(OCc4ccccc4)cc3)c2)c2c(N)ncnn12
Standard InChI: InChI=1S/C30H28N6O3/c1-19(2)26-16-25(27-29(31)32-18-33-36(26)27)28(37)21-9-6-10-23(15-21)35-30(38)34-22-11-13-24(14-12-22)39-17-20-7-4-3-5-8-20/h3-16,18-19H,17H2,1-2H3,(H2,31,32,33)(H2,34,35,38)
Standard InChI Key: KKVKEHQMNCTHOL-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
2.2070 -4.4126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2058 -5.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9206 -5.6529 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9188 -3.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6342 -4.4090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6390 -5.2354 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4266 -5.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9085 -4.8147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4188 -4.1490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9164 -3.1747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6861 -6.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1376 -6.8857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4941 -6.4362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6691 -3.3629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4751 -3.1867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1135 -2.7530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0273 -3.7967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8326 -3.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0837 -2.8341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5231 -2.2229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7199 -2.4018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3879 -4.2312 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1940 -4.0552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7494 -4.6654 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4447 -3.2692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5554 -4.4895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1075 -5.1015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9128 -4.9262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1642 -4.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6041 -3.5280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8007 -3.7065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9700 -3.9625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5262 -4.5719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3321 -4.3949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8829 -5.0063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6880 -4.8300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9384 -4.0429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3774 -3.4321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5744 -3.6117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 6 1 0
5 4 1 0
4 1 2 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
4 10 1 0
7 11 1 0
11 12 1 0
11 13 1 0
9 14 1 0
14 15 1 0
14 16 2 0
15 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 15 1 0
18 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
32 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.59Molecular Weight (Monoisotopic): 520.2223AlogP: 5.89#Rotatable Bonds: 8Polar Surface Area: 123.64Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.52CX Basic pKa: 0.46CX LogP: 5.82CX LogD: 5.82Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.22Np Likeness Score: -1.10