3'-((2-(6-methoxy-2-methylquinolin-4-yl)hydrazono)methyl)phenol

ID: ALA4467366

PubChem CID: 155532551

Max Phase: Preclinical

Molecular Formula: C18H17N3O2

Molecular Weight: 307.35

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2nc(C)cc(N/N=C/c3cccc(O)c3)c2c1

Standard InChI:  InChI=1S/C18H17N3O2/c1-12-8-18(16-10-15(23-2)6-7-17(16)20-12)21-19-11-13-4-3-5-14(22)9-13/h3-11,22H,1-2H3,(H,20,21)/b19-11+

Standard InChI Key:  WFGDLFDTVVITRH-YBFXNURJSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
    4.2579  -21.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2567  -22.3265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9648  -22.7355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9630  -21.0981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6716  -21.5034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6724  -22.3224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3809  -22.7294    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0892  -22.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0844  -21.4965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3753  -21.0931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7985  -22.7245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3710  -20.2759    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0765  -19.8636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5501  -21.0985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5499  -20.2813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7864  -20.2684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4919  -19.8561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2003  -20.2658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9053  -19.8541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9014  -19.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1866  -18.6314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4845  -19.0454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6150  -20.2593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  8 11  1  0
 10 12  1  0
 12 13  1  0
  1 14  1  0
 14 15  1  0
 13 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 19 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4467366

    ---

Associated Targets(Human)

NQO2 Tchem Quinone reductase 2 (885 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 307.35Molecular Weight (Monoisotopic): 307.1321AlogP: 3.70#Rotatable Bonds: 4
Polar Surface Area: 66.74Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.19CX Basic pKa: 7.42CX LogP: 3.50CX LogD: 3.31
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.57Np Likeness Score: -1.08

References

1. Hussein B, Ikhmais B, Kadirvel M, Magwaza RN, Halbert G, Bryce RA, Stratford IJ, Freeman S..  (2019)  Discovery of potent 4-aminoquinoline hydrazone inhibitors of NRH:quinoneoxidoreductase-2 (NQO2).,  182  [PMID:31514018] [10.1016/j.ejmech.2019.111649]

Source