The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-3-Isopropyl-N-((1-(4-(trifluoromethyl)phenethyl)pyrrolidin-3-yl)methyl)isoxazole-5-carboxamide ID: ALA4467412
PubChem CID: 153635975
Max Phase: Preclinical
Molecular Formula: C21H26F3N3O2
Molecular Weight: 409.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1cc(C(=O)NC[C@H]2CCN(CCc3ccc(C(F)(F)F)cc3)C2)on1
Standard InChI: InChI=1S/C21H26F3N3O2/c1-14(2)18-11-19(29-26-18)20(28)25-12-16-8-10-27(13-16)9-7-15-3-5-17(6-4-15)21(22,23)24/h3-6,11,14,16H,7-10,12-13H2,1-2H3,(H,25,28)/t16-/m1/s1
Standard InChI Key: LTWGACDJHKRMQA-MRXNPFEDSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
4.5564 -8.5805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3736 -8.5805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6280 -7.8038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9650 -7.3217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3063 -7.8038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4055 -7.5524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0121 -8.1000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7896 -7.8486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3961 -8.3962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9606 -7.0495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0752 -9.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2626 -9.1546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7814 -9.8151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9685 -9.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4875 -10.3858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8189 -11.1337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6360 -11.2180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1134 -10.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3386 -11.7949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5259 -11.7095 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.6710 -12.5414 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.9245 -12.4972 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.3113 -9.2075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0574 -9.5409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6051 -8.9343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1974 -8.2261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4177 -9.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7491 -9.7678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8989 -8.3603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
3 6 1 6
6 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
1 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
19 20 1 0
19 21 1 0
19 22 1 0
9 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 9 2 0
25 27 1 0
27 28 1 0
27 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 409.45Molecular Weight (Monoisotopic): 409.1977AlogP: 4.11#Rotatable Bonds: 7Polar Surface Area: 58.37Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.45CX Basic pKa: 9.03CX LogP: 3.68CX LogD: 2.05Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.75Np Likeness Score: -1.71
References 1. Son WS, Jeong KS, Lim SM, Pae AN.. (2019) Structural hybridization of pyrrolidine-based T-type calcium channel inhibitors and exploration of their analgesic effects in a neuropathic pain model., 29 (10): [PMID:30928197 ] [10.1016/j.bmcl.2019.03.026 ]