(R)-3-Isopropyl-N-((1-(4-(trifluoromethyl)phenethyl)pyrrolidin-3-yl)methyl)isoxazole-5-carboxamide

ID: ALA4467412

PubChem CID: 153635975

Max Phase: Preclinical

Molecular Formula: C21H26F3N3O2

Molecular Weight: 409.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)c1cc(C(=O)NC[C@H]2CCN(CCc3ccc(C(F)(F)F)cc3)C2)on1

Standard InChI:  InChI=1S/C21H26F3N3O2/c1-14(2)18-11-19(29-26-18)20(28)25-12-16-8-10-27(13-16)9-7-15-3-5-17(6-4-15)21(22,23)24/h3-6,11,14,16H,7-10,12-13H2,1-2H3,(H,25,28)/t16-/m1/s1

Standard InChI Key:  LTWGACDJHKRMQA-MRXNPFEDSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
    4.5564   -8.5805    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3736   -8.5805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6280   -7.8038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9650   -7.3217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3063   -7.8038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4055   -7.5524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0121   -8.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7896   -7.8486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3961   -8.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9606   -7.0495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0752   -9.2410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2626   -9.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7814   -9.8151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9685   -9.7261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4875  -10.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8189  -11.1337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6360  -11.2180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1134  -10.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3386  -11.7949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5259  -11.7095    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.6710  -12.5414    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.9245  -12.4972    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.3113   -9.2075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0574   -9.5409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6051   -8.9343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1974   -8.2261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4177   -9.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7491   -9.7678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8989   -8.3603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  3  6  1  6
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  1 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 16 19  1  0
 19 20  1  0
 19 21  1  0
 19 22  1  0
  9 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26  9  2  0
 25 27  1  0
 27 28  1  0
 27 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4467412

    ---

Associated Targets(Human)

CACNA1H Tclin Voltage-gated T-type calcium channel alpha-1H subunit (1913 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CACNA1G Tclin Voltage-gated T-type calcium channel alpha-1G subunit (1361 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KCNH2 Tclin HERG (29587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 409.45Molecular Weight (Monoisotopic): 409.1977AlogP: 4.11#Rotatable Bonds: 7
Polar Surface Area: 58.37Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.45CX Basic pKa: 9.03CX LogP: 3.68CX LogD: 2.05
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.75Np Likeness Score: -1.71

References

1. Son WS, Jeong KS, Lim SM, Pae AN..  (2019)  Structural hybridization of pyrrolidine-based T-type calcium channel inhibitors and exploration of their analgesic effects in a neuropathic pain model.,  29  (10): [PMID:30928197] [10.1016/j.bmcl.2019.03.026]

Source