The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-bromophenyl)(2-(2-(3-(4-ethoxyphenyl)-1-phenyl-1H-pyrazol-4-yl)vinyl)-7H-furo[2,3-f]chromen-3-yl)methanone ID: ALA4467724
PubChem CID: 155532681
Max Phase: Preclinical
Molecular Formula: C37H27BrN2O4
Molecular Weight: 643.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C/c2oc3c4c(ccc3c2C(=O)c2ccc(Br)cc2)OCC=C4)cc1
Standard InChI: InChI=1S/C37H27BrN2O4/c1-2-42-29-17-12-24(13-18-29)35-26(23-40(39-35)28-7-4-3-5-8-28)14-20-33-34(36(41)25-10-15-27(38)16-11-25)31-19-21-32-30(37(31)44-33)9-6-22-43-32/h3-21,23H,2,22H2,1H3/b20-14+
Standard InChI Key: KLQNVBVGAHWMAP-XSFVSMFZSA-N
Molfile:
RDKit 2D
44 50 0 0 0 0 0 0 0 0999 V2000
19.3470 -3.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0563 -3.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7690 -3.6077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7738 -4.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5580 -4.6830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0395 -4.0137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5502 -3.3502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8608 -4.0089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2735 -4.7183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0948 -4.7135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7982 -2.5674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6006 -2.3929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2478 -1.9592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0581 -4.8480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3530 -4.4347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6460 -4.8426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6419 -5.6613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3469 -6.0704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0601 -5.6651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1517 -2.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9535 -2.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2021 -2.0396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6470 -1.4342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8473 -1.6114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5833 -5.3716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3631 -5.1145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3583 -4.2931 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5755 -4.0453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0158 -3.8070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7689 -4.1407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4268 -3.6530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3368 -2.8358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5793 -2.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9246 -2.9941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0044 -1.8639 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
24.3355 -6.1544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5318 -6.3293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2798 -7.1113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8347 -7.7163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6406 -7.5380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8848 -6.7563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5879 -8.4994 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7857 -8.6752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2303 -8.0720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 15 2 0
14 4 2 0
3 2 2 0
2 1 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 3 1 0
6 8 1 0
8 9 2 0
9 10 1 0
7 11 1 0
11 12 1 0
11 13 2 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
12 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 12 1 0
10 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
28 10 2 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
27 29 1 0
22 35 1 0
25 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
39 42 1 0
42 43 1 0
43 44 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 643.54Molecular Weight (Monoisotopic): 642.1154AlogP: 9.25#Rotatable Bonds: 8Polar Surface Area: 66.49Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 1.37CX LogP: 9.14CX LogD: 9.14Aromatic Rings: 6Heavy Atoms: 44QED Weighted: 0.15Np Likeness Score: -0.35
References 1. Xu Z, Zhao S, Lv Z, Feng L, Wang Y, Zhang F, Bai L, Deng J.. (2019) Benzofuran derivatives and their anti-tubercular, anti-bacterial activities., 162 [PMID:30448416 ] [10.1016/j.ejmech.2018.11.025 ]