3-(3,5-Dibromophenyl)-N-[N'-(2-thiophen-2-ylacetyl)hydrazinocarbothioyl]acrylamide

ID: ALA4468035

PubChem CID: 117722684

Max Phase: Preclinical

Molecular Formula: C16H13Br2N3O2S2

Molecular Weight: 503.24

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(/C=C/c1cc(Br)cc(Br)c1)NC(=S)NNC(=O)Cc1cccs1

Standard InChI:  InChI=1S/C16H13Br2N3O2S2/c17-11-6-10(7-12(18)8-11)3-4-14(22)19-16(24)21-20-15(23)9-13-2-1-5-25-13/h1-8H,9H2,(H,20,23)(H2,19,21,22,24)/b4-3+

Standard InChI Key:  VMCLLLFTVMTWJC-ONEGZZNKSA-N

Molfile:  

 
     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
    4.9651   -3.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6728   -2.8024    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3805   -3.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0882   -2.8024    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7959   -3.2110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5036   -2.8024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2113   -3.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9190   -2.8024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2573   -2.8024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9651   -4.0282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5036   -1.9852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3805   -4.0282    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.6661   -3.1300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2129   -2.5227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8043   -1.8150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0050   -1.9850    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.5496   -3.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8419   -2.8024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8471   -1.9841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1402   -1.5756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4315   -1.9843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4341   -2.8057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1416   -3.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1406   -0.7584    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    0.7279   -3.2168    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  1  9  1  0
  1 10  2  0
  6 11  2  0
  3 12  2  0
  8 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16  8  1  0
  9 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 20 24  1  0
 22 25  1  0
M  END

Associated Targets(Human)

SRR Tbio Serine racemase (249 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 503.24Molecular Weight (Monoisotopic): 500.8816AlogP: 3.55#Rotatable Bonds: 4
Polar Surface Area: 70.23Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.60CX Basic pKa: CX LogP: 4.57CX LogD: 4.57
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.34Np Likeness Score: -2.04

References

1.  (2014)  Serine racemase inhibitor, 

Source