N-(3-Methoxyphenyl)-7-((4-methoxyphenyl)sulfonyl)-5,6,7,8-tetrahydropyrido[4',3':4,5]thieno[2,3-d]pyrimidin-4-amine

ID: ALA4468342

PubChem CID: 155533012

Max Phase: Preclinical

Molecular Formula: C23H22N4O4S2

Molecular Weight: 482.59

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)N2CCc3c(sc4ncnc(Nc5cccc(OC)c5)c34)C2)cc1

Standard InChI:  InChI=1S/C23H22N4O4S2/c1-30-16-6-8-18(9-7-16)33(28,29)27-11-10-19-20(13-27)32-23-21(19)22(24-14-25-23)26-15-4-3-5-17(12-15)31-2/h3-9,12,14H,10-11,13H2,1-2H3,(H,24,25,26)

Standard InChI Key:  HTIGEXOQZKRNPW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   22.5470  -21.5111    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5512  -20.6939    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.8414  -21.0989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1805  -18.6633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1794  -19.4828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8874  -19.8918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5971  -19.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5942  -18.6597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8856  -18.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4713  -19.8909    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.4707  -20.7081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4695  -22.3409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.1799  -21.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1774  -21.1134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7616  -21.9310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7584  -21.1150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9865  -22.1860    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   24.5043  -21.5278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9828  -20.8703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6546  -20.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8468  -20.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3685  -20.7004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6975  -21.4462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1475  -19.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5643  -19.2808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1612  -18.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3431  -18.5648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9299  -19.2747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3354  -19.9818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9384  -17.8549    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3508  -17.1494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8832  -17.4372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5897  -17.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  5 10  1  0
 10 11  1  0
 11 16  2  0
 15 12  2  0
 12 13  1  0
 13 14  2  0
 14 11  1  0
 15 16  1  0
 16 19  1  0
 18 17  1  0
 17 15  1  0
 18 19  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22  2  1  0
  2 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
 30 31  1  0
  9 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4468342

    ---

Associated Targets(Human)

SUNE1 (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MKNK1 Tchem MAP kinase-interacting serine/threonine-protein kinase MNK1 (2071 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
786-0 (47912 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.59Molecular Weight (Monoisotopic): 482.1082AlogP: 4.20#Rotatable Bonds: 6
Polar Surface Area: 93.65Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.53CX LogP: 3.96CX LogD: 3.96
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.44Np Likeness Score: -2.01

References

1. Zhang M, Jiang L, Tao J, Pan Z, He M, Su D, He G, Jiang Q..  (2019)  Design, synthesis and biological evaluation of 4-aniline-thieno[2,3-d]pyrimidine derivatives as MNK1 inhibitors against renal cell carcinoma and nasopharyngeal carcinoma.,  27  (11): [PMID:31014565] [10.1016/j.bmc.2019.04.022]

Source