3-(4-Nitrophenyl)-N-[N'-(2-thiophen-2-ylacetyl)hydrazinocarbothioyl]acrylamide

ID: ALA4468594

PubChem CID: 71696203

Max Phase: Preclinical

Molecular Formula: C16H14N4O4S2

Molecular Weight: 390.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NC(=S)NNC(=O)Cc1cccs1

Standard InChI:  InChI=1S/C16H14N4O4S2/c21-14(8-5-11-3-6-12(7-4-11)20(23)24)17-16(25)19-18-15(22)10-13-2-1-9-26-13/h1-9H,10H2,(H,18,22)(H2,17,19,21,25)/b8-5+

Standard InChI Key:  YPOCGFLBPITFQR-VMPITWQZSA-N

Molfile:  

 
     RDKit          2D

 26 27  0  0  0  0  0  0  0  0999 V2000
   17.3674  -28.1807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0751  -27.7721    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7828  -28.1807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4905  -27.7721    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.1982  -28.1807    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9059  -27.7721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6136  -28.1807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3213  -27.7721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6597  -27.7721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3674  -28.9979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9059  -26.9549    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7828  -28.9979    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.0684  -28.0998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6152  -27.4925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2066  -26.7847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4073  -26.9547    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.9520  -28.1807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2443  -27.7721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2494  -26.9539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5425  -26.5453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8338  -26.9540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8365  -27.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5439  -28.1802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1246  -26.5469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4175  -26.9564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1235  -25.7297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  1  9  1  0
  1 10  2  0
  6 11  2  0
  3 12  2  0
  8 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16  8  1  0
  9 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 24 25  2  0
 24 26  1  0
 21 24  1  0
M  CHG  2  24   1  26  -1
M  END

Associated Targets(Human)

SRR Tbio Serine racemase (249 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 390.45Molecular Weight (Monoisotopic): 390.0456AlogP: 1.93#Rotatable Bonds: 5
Polar Surface Area: 113.37Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.67CX Basic pKa: CX LogP: 2.97CX LogD: 2.97
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.31Np Likeness Score: -2.26

References

1.  (2014)  Serine racemase inhibitor, 

Source