3-(2-Amino-4-methylquinolin-7-yl)-5-(aminomethyl)benzonitrile Dihydrochloride

ID: ALA4468616

PubChem CID: 155533197

Max Phase: Preclinical

Molecular Formula: C18H18Cl2N4

Molecular Weight: 288.35

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(N)nc2cc(-c3cc(C#N)cc(CN)c3)ccc12.Cl.Cl

Standard InChI:  InChI=1S/C18H16N4.2ClH/c1-11-4-18(21)22-17-8-14(2-3-16(11)17)15-6-12(9-19)5-13(7-15)10-20;;/h2-8H,9,19H2,1H3,(H2,21,22);2*1H

Standard InChI Key:  KFUZFYNKBQQYHZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 24  0  0  0  0  0  0  0  0999 V2000
   16.6946   -6.2156    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   14.8855   -3.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8844   -4.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5965   -5.0627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5947   -3.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3075   -3.8223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3082   -4.6454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0209   -5.0566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7333   -4.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7286   -3.8154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0153   -3.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1722   -5.0617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5923   -2.5999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4390   -5.0435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4416   -5.8618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1504   -6.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8572   -5.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8506   -5.0335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1412   -4.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5549   -4.6190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2660   -5.0217    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1521   -7.0880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1556   -7.9052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4764   -2.6290    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  3 12  1  0
  5 13  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  9 14  1  0
 18 20  1  0
 20 21  1  0
 22 23  3  0
 16 22  1  0
M  END

Associated Targets(non-human)

Nos1 Nitric-oxide synthase, brain (2987 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 288.35Molecular Weight (Monoisotopic): 288.1375AlogP: 3.12#Rotatable Bonds: 2
Polar Surface Area: 88.72Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.07CX LogP: 3.04CX LogD: 1.29
Aromatic Rings: 3Heavy Atoms: 22QED Weighted: 0.76Np Likeness Score: -0.73

References

1. Cinelli MA, Reidl CT, Li H, Chreifi G, Poulos TL, Silverman RB..  (2020)  First Contact: 7-Phenyl-2-Aminoquinolines, Potent and Selective Neuronal Nitric Oxide Synthase Inhibitors That Target an Isoform-Specific Aspartate.,  63  (9): [PMID:32302123] [10.1021/acs.jmedchem.9b01573]

Source