1-(1-Phenyl-1H-pyrrol-3-ylmethyl)-4-(3-trifluoromethyl-phenyl)-piperidin-4-ol

ID: ALA446892

PubChem CID: 10597114

Max Phase: Preclinical

Molecular Formula: C23H23F3N2O

Molecular Weight: 400.44

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  OC1(c2cccc(C(F)(F)F)c2)CCN(Cc2ccn(-c3ccccc3)c2)CC1

Standard InChI:  InChI=1S/C23H23F3N2O/c24-23(25,26)20-6-4-5-19(15-20)22(29)10-13-27(14-11-22)16-18-9-12-28(17-18)21-7-2-1-3-8-21/h1-9,12,15,17,29H,10-11,13-14,16H2

Standard InChI Key:  TVQJPTVBALUGFW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    2.9167   -0.8625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7792   -5.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2167   -0.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6667   -1.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0500   -2.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0000   -0.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1917   -5.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8042    0.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3792   -1.4167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8292   -3.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4042   -4.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2292   -2.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5375   -2.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0417   -0.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2042   -1.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3042   -6.2042    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.6875   -6.5292    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.6292   -5.5917    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.2000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8917   -2.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8417   -3.1375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3917   -5.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0292   -3.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8167   -4.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2042   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4917   -0.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4917   -2.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7792   -1.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7792   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  7  1  0
  3  4  2  0
  4  1  1  0
  5 12  1  0
  6  1  1  0
  7 11  2  0
  8  6  2  0
  9 14  1  0
 10  5  1  0
 11 10  1  0
 12 20  1  0
 13 19  1  0
 14  3  1  0
 15  1  1  0
 16  2  1  0
 17  2  1  0
 18  2  1  0
 19  9  1  0
 20  9  1  0
 21  5  1  0
 22 24  2  0
 23 10  2  0
 24 23  1  0
 25 15  1  0
 26 15  2  0
 27 25  2  0
 28 26  1  0
 29 28  2  0
  3  8  1  0
 29 27  1  0
  5 13  1  0
  7 22  1  0
M  END

Associated Targets(Human)

DRD4 Tchem Dopamine D4 receptor (7907 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

DRD2 Dopamine D2 receptor (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DRD3 Dopamine D3 receptor (16 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 400.44Molecular Weight (Monoisotopic): 400.1762AlogP: 4.98#Rotatable Bonds: 4
Polar Surface Area: 28.40Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.93CX Basic pKa: 8.23CX LogP: 4.72CX LogD: 3.83
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -1.08

References

1. Thurkauf A, Yuan J, Chen X, Wasley JW, Meade R, Woodruff KH, Huston K, Ross PC..  (1995)  1-Phenyl-3-(aminomethyl)pyrroles as potential antipsychotic agents. Synthesis and dopamine receptor binding.,  38  (25): [PMID:8523409] [10.1021/jm00025a013]

Source