The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(1-Phenyl-1H-pyrrol-3-ylmethyl)-4-(3-trifluoromethyl-phenyl)-piperidin-4-ol ID: ALA446892
PubChem CID: 10597114
Max Phase: Preclinical
Molecular Formula: C23H23F3N2O
Molecular Weight: 400.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: OC1(c2cccc(C(F)(F)F)c2)CCN(Cc2ccn(-c3ccccc3)c2)CC1
Standard InChI: InChI=1S/C23H23F3N2O/c24-23(25,26)20-6-4-5-19(15-20)22(29)10-13-27(14-11-22)16-18-9-12-28(17-18)21-7-2-1-3-8-21/h1-9,12,15,17,29H,10-11,13-14,16H2
Standard InChI Key: TVQJPTVBALUGFW-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
2.9167 -0.8625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7792 -5.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2167 -0.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6667 -1.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0500 -2.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0000 -0.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1917 -5.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8042 0.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3792 -1.4167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8292 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4042 -4.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2292 -2.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5375 -2.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0417 -0.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2042 -1.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3042 -6.2042 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.6875 -6.5292 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.6292 -5.5917 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.2000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8917 -2.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8417 -3.1375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3917 -5.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0292 -3.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8167 -4.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2042 -2.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4917 -0.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4917 -2.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7792 -1.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7792 -2.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 7 1 0
3 4 2 0
4 1 1 0
5 12 1 0
6 1 1 0
7 11 2 0
8 6 2 0
9 14 1 0
10 5 1 0
11 10 1 0
12 20 1 0
13 19 1 0
14 3 1 0
15 1 1 0
16 2 1 0
17 2 1 0
18 2 1 0
19 9 1 0
20 9 1 0
21 5 1 0
22 24 2 0
23 10 2 0
24 23 1 0
25 15 1 0
26 15 2 0
27 25 2 0
28 26 1 0
29 28 2 0
3 8 1 0
29 27 1 0
5 13 1 0
7 22 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 400.44Molecular Weight (Monoisotopic): 400.1762AlogP: 4.98#Rotatable Bonds: 4Polar Surface Area: 28.40Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.93CX Basic pKa: 8.23CX LogP: 4.72CX LogD: 3.83Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -1.08
References 1. Thurkauf A, Yuan J, Chen X, Wasley JW, Meade R, Woodruff KH, Huston K, Ross PC.. (1995) 1-Phenyl-3-(aminomethyl)pyrroles as potential antipsychotic agents. Synthesis and dopamine receptor binding., 38 (25): [PMID:8523409 ] [10.1021/jm00025a013 ]